欣百诺novoprotein重组蛋白目录
欣百诺novoprotein重组蛋白目录
| 产品编号 | 产品名称 | 种属 | 表达系统 | 10ug¥ | 50ug¥ |
| CE07 | 14-3-3 protein epsilon/YWHAE | Human | E.coli | 1200 | 3520 |
| CI63 | 3-hydroxyacyl-CoA dehydrogenase type-2/HSD17B10 | Human | Human cells | 1200 | 3520 |
| CS18 | 4-1BB Ligand/4-1BBL/TNFSF9/CD137L | Human | Human Cells | 760 | 2000 |
| CP05 | 4-1BB/TNFRSF9/CD137 (C-6His) | Human | Human cells | 240 | 720 |
| CP10 | 4-1BB/TNFRSF9/CD137 (C-Fc) | Human | Human Cells | 240 | 720 |
| C446 | 5'-Nucleotidase/NT5E/CD73 | Human | Human cells | 1200 | 3520 |
| CI98 | 5'-Nucleotidase/NT5E/CD73 | Mouse | Human cells | 1200 | 3520 |
| CI74 | 6-phosphogluconate dehydrogenase, decarboxylating/PGD | Human | Human cells | 400 | 1200 |
| CF46 | ACADM/MCAD | Human | E.coli | 840 | 2520 |
| C419 | ACE-2 | Human | Human cells | 1200 | 3520 |
| C891 | ACOT13/Acyl-coenzyme A thioesterase 13 | Human | Human cells | 840 | 2520 |
| CE15 | Actin, cytoplasmic 1/ACTB | Human | E.coli | 1200 | 3520 |
| CF89 | Actin-related protein 8/ACTR8/ARP8/INO80N | Human | E.coli | 1200 | 3520 |
| CM15 | Activin Receptor IB/Activin RIB/ALK-4/ACVR1B | Mouse | Human Cells | 600 | 1440 |
| CB60 | Activin receptor type-2A/Activin RIIA | Human | Human cells | 400 | 1200 |
| C561 | Activin receptor type-2A/ACVR2A | Human | Human cells | 560 | 1680 |
| C302 | Activin receptor type-2B/ACVR2B | Human | Human cells | 400 | 1200 |
| CD58 | Activin receptor type-2B/ACVR2B (Fc fusion) | Human | Human cells | 400 | 1200 |
| CK71 | Activin Receptor-like Kinase 1/ALK-1/ACVRL1 | Mouse | Human Cells | 240 | 720 |
| CA76 | Activin RIA/ALK-2 | Human | Human cells | 400 | 840 |
| CA60 | Activin RIB/ALK-4 | Human | Human cells | 400 | 840 |
| CH99 | ACY3/N-acyl-aromatic-L-amino acid amidohydrolase | Human | E.coli | 840 | 2520 |
| CH97 | Acylphosphatase-1/ACYP1 | Human | E.coli | 400 | 1200 |
| CH96 | ACYP2/Acylphosphatase-2 | Human | E.coli | 760 | 2000 |
| CC55 | ADAMDEC1/ADAM-like protein decysin-1 | Human | Human cells | 760 | 2000 |
| C552 | Adiponectin/Acrp30 | Human | Human cells | 640 | 1760 |
| CH26 | Adiponectin/Acrp30/ADIPOQ | Mouse | E.coli | 760 | 2000 |
| CI89 | Adiponectin/Acrp30/ADIPOQ | Mouse | Human cells | 760 | 2000 |
| CE44 | ADP-ribosylarginine hydrolase/ADPRH/ARH1 | Human | E.coli | 1200 | 3520 |
| C424 | AG-2/HPC8/AGR2 | Human | Human cells | 840 | 2520 |
| C553 | AG-3/hAG-3/AGR3 | Human | Human cells | 840 | 2520 |
| C423 | AGER/RAGE | Human | Human cells | 640 | 1760 |
| C004 | Albumin-IFN-α2b/HSA-IFNα2b | Human | P. pastoris | 840 | 2520 |
| CK41 | ALCAM/CD166 | Mouse | Human cells | 760 | 2280 |
| C882 | Alcohol dehydrogenase class 4 mu/sigma chain/ADH7 | Human | Human cells | 1200 | 3520 |
| CF44 | Aldehyde Dehydrogenase 1-A1/ALDH1A1 | Human | E.coli | 760 | 2280 |
| CP08 | Aldehyde Dehydrogenase 1-A2/ALDH1A2 | Human | E.coli | 760 | 2000 |
| CP15 | Aldehyde Dehydrogenase 1-A3/ALDH1A3 | Human | E.coli | 760 | 2000 |
| CJ61 | ALDH3A1/Aldehyde dehydrogenase family 3 member A1 | Human | Human cells | 840 | 2520 |
| CC48 | ALDOC/Fructose-bisphosphate aldolase C | Human | Human cells | 760 | 2280 |
| CE36 | Aldo-keto Reductase 1C4/AKR1C4 | Human | E.coli | 1200 | 3520 |
| C295 | Aldo-keto reductase family 1 member C2/AKR1C2 | Human | E.coli | 1200 | 3520 |
| C278 | Aldose 1-epimerase/GALM | Human | E.coli | 1200 | 3520 |
| CJ03 | ALK-3/BMPRIA | Mouse | Human cells | 400 | 840 |
| C554 | Alkaline Phosphatase/ALPL | Human | Human cells | 1200 | 3520 |
| CB45 | Alkaline Phosphatase/ALPP/PLAP | Human | Human cells | 1200 | 3520 |
| CF31 | Allograft inflammatory factor 1/AIF1 | Human | E.coli | 840 | 2520 |
| CD54 | alpha-1-acid glycoprotein 2/AGP2/ORM2 | Human | Human cells | 760 | 2000 |
| C351 | alpha-Galactosidase A/GLA | Human | Human cells | 936 | 2800 |
| CE90 | alpha-Parvin/PARVA/MXRA2 | Human | E.coli | 1200 | 3520 |
| CH45 | Alpha-synuclein/SNCA | Human | E.coli | 400 | 840 |
| C947 | Ameloblastin/AMBN | Human | Human cells | 1200 | 3520 |
| C555 | AMIGO2/Adhesion molecule with Ig-like domain 2 Protein | Human | Human cells | 840 | 2520 |
| C426 | AMIGO3/Amphoterin-induced protein 3 | Human | Human cells | 840 | 2520 |
| CI90 | Amiloride-binding protein 1/ABP1 | Human | Human cells | 400 | 1200 |
| C193 | Aminopeptidase P1/XPNPEP1 | Human | E.coli | 1200 | 3520 |
| C509 | Aminopeptidase P2/XPNPEP2 | Human | Human cells | 1200 | 3520 |
| CG04 | Amphiregulin/AREG/AREGB/CRDGF/SDGF | Human | E.coli | 480 | 1440 |
| CI36 | AMY2B/Alpha-amylase 2B |
Human | Human cells | 760 | 2000 |
| C203 | Angiogenin/ANG/RNASE5 | Human | E.coli | 640 | 1760 |
| C797 | Angiopoietin-like Protein 8/Betatrophin /C19orf81 | Human | Human cells | 1200 | 3520 |
| C761 | Angiopoietin-related protein 4/ANGPTL4 | Mouse | Human cells | 760 | 2000 |
| CG53 | Ankyrin repeat and SOCS box protein 13/ASB13 | Human | E.coli | 1200 | 3520 |
| C093 | Annexin A1/ANXA1 | Human | E.coli | 1200 | 3520 |
| CF04 | Annexin A10/ANXA10 | Human | E.coli | 1200 | 3520 |
| C204 | Annexin A13/ANXA13 | Human | E.coli | 840 | 2520 |
| C205 | Annexin A2/ANXA2 | Human | E.coli | 840 | 2520 |
| CH57 | Annexin A3/ANXA3 | Human | E.coli | 1200 | 3520 |
| C206 | Annexin A5/ANXA5 | Human | E.coli | 840 | 2520 |
| C207 | Annexin A6/ANXA6 | Human | E.coli | 640 | 1760 |
| C208 | Annexin A7/ANXA7 | Human | E.coli | 840 | 2520 |
| C209 | Annexin A8/ANXA8 | Human | E.coli | 840 | 2520 |
| CA34 | Anthrax toxin receptor 1/ANTXR1/ATR | Human | Human cells | 840 | 2520 |
| CE16 | APBA3/Amyloid beta A4 precursor protein-binding family A member 3 | Human | E.coli | 1200 | 3520 |
| C101 | APE/APE1/APEX | Human | E.coli | 840 | 2520 |
| C511 | Apolipoprotein A-I/ApoA1 | Human | Human cells | 840 | 2520 |
| CK19 | Apolipoprotein A-I/ApoA1 | Human | E.coli | 840 | 2520 |
| CH52 | Apolipoprotein A-I/ApoA1(C-polyHis) | Human | E.coli | 400 | 840 |
| CC76 | Apolipoprotein A-II/ApoA2 | Human | Human cells | 1200 | 3520 |
| CA08 | Apolipoprotein A-IV/ApoA4 | Human | Human cells | 1200 | 3520 |
| CB66 | Apolipoprotein C-II/ApoC2 | Human | E.coli | 1200 | 3520 |
| C556 | Apolipoprotein D/ApoD | Human | Human cells | 840 | 2520 |
| CI02 | Apolipoprotein E/ApoE | Human | Human cells | 80 | 320 |
| CJ05 | Apolipoprotein E/Apo-E/APOE | Mouse | Human cells | 840 | 3320 |
| C432 | Apolipoprotein H/ApoH | Human | Human cells | 840 | 2520 |
| CD33 | Apolipoprotein J/ApoJ/Clusterin/CLU/CLI/KUB1 | Human | Human cells | 760 | 2000 |
| C557 | Apolipoprotein M/ApoM | Human | Human cells | 840 | 2520 |
| C097 | APT-1/LYPLA1 |
Human | E.coli | 840 | 2520 |
| C153 | ARC/NOL3 | Human | E.coli | 840 | 2520 |
| C197 | ARC/NOL3 (GST) | Human | E.coli | 840 | 2520 |
| CG78 | Arginase-1/ARG1 | Human | E.coli | 1200 | 3520 |
| CP77 | Arginase-1/ARG1 | Human | Human cells | 1440 | 4320 |
| CE71 | Arginase-2/ARG2 | Human | E.coli | 840 | 2520 |
| CD99 | ARHGAP25/Rho GTPase-activating protein 25 | Human | Human cells | 1200 | 3520 |
| C985 | ARK1C3/Aldo-keto reductase family 1 member C3 | Human | Human cells | 1200 | 3520 |
| CD02 | ARMET/MANF | Human | Human cells | 760 | 2000 |
| C102 | ARRB1/β-Arrestin 1 | Human | E.coli | 840 | 2520 |
| C301 | Arylsulfatase A/ARSA | Human | Human cells | 936 | 2800 |
| C427 | ASAM/CXADR-like membrane protein/CLMP | Human | Human cells | 640 | 1760 |
| C428 | Asialoglycoprotein receptor 1/ASGPR1 | Human | Human cells | 640 | 1760 |
| C145 | Aspartate Aminotransferase, Cytoplasmic/GOT1 | Human | E.coli | 840 | 2520 |
| CE20 | ASS1/Argininosuccinate synthase | Human | E.coli | 1200 | 3520 |
| CG54 | ASXL1/KIAA0978 | Human | E.coli | 1200 | 3520 |
| CH61 | ATF1/Cyclic AMP-dependent transcription factor ATF-1 | Human | E.coli | 1200 | 3520 |
| CE33 | ATG10/Ubiquitin-like-conjugating enzyme ATG10 | Human | E.coli | 1200 | 3520 |
| CE30 | ATG3/Apg3L/Apg3p | Human | E.coli | 240 | 640 |
| CF50 | ATG4A | Human | E.coli | 1200 | 3520 |
| CE84 | ATG4C/Autophagin-3 | Human | E.coli | 1200 | 3520 |
| CG58 | ATG5/Autophagy protein 5/APG5L/ASP | Human | E.coli | 840 | 2520 |
| CG47 | ATP-binding cassette sub-family B member 5/ABCB5 | Human | E.coli | 1200 | 3520 |
| C430 | Azurocidin/CAP37/HBP | Human | Human cells | 640 | 1760 |
| C512 | B2M/β2-Microglobulin | Human | Human cells | 840 | 2520 |
| CH02 | B2M/β2-Microglobulin | Human | E.coli | 240 | 640 |
| CK05 | B3GAT3/GLCATI | Human | E.coli | 840 | 2520 |
| C963 | B3GNT1/β-1,3-N-acetylglucosaminyltransferase 1 | Human | Human cells | 840 | 2520 |
| CC85 | B4GALT3/β-1,4-galactosyltransferase 3 | Human | Human cells | 1200 | 3520 |
| C513 | B4GALT4/β-1,4-Galactosyltransferase 4 | Human | Human cells | 840 | 2520 |
| CS41 | B7 Homolog 6/B7-H6/NCR3LG1 | Human | Human cells | 760 | 2000 |
| CK87 | B7-1/CD80 | Mouse | Human Cells | 240 | 720 |
| CK61 | B7-1/CD80 | Human | Human cells | 400 | 1280 |
| C404 | B7-2/CD86 | Human | Human cells | 400 | 1200 |
| CK79 | B7-2/CD86 | Mouse | Human Cells | 240 | 720 |
| CA09 | B7-DC/PD-L2 | Human | Human cells | 1200 | 3520 |
| CJ99 | B7-DC/PD-L2/CD273 | Mouse | Human cells | 400 | 1120 |
| C315 | B7-H1/PD-L1 | Human | Human cells | 320 | 960 |
| CK62 | B7-H3/CD276 | Human | Human cells | 760 | 2280 |
| CM83 | B7-H3/CD276 | Mouse | Human Cells | 600 | 1440 |
| CC59 | Bactericidal permeability-increasing protein/BPI/CAP57 | Human | Human cells | 760 | 2000 |
| CE87 | Baculoviral Iap Repeat-Containing Protein 5/Birc5 | Human | E.coli | 760 | 2000 |
| CE40 | BAG family molecular chaperone regulator 2/BAG2 | Human | E.coli | 1200 | 3520 |
| CE68 | BCAS2/DAM1/Pre-mRNA-splicing factor SPF27 | Human | E.coli | 1200 | 3520 |
| C103 | BCL2A1/Bcl-2 related protein A1 | Human | E.coli | 640 | 1760 |
| C104 | BCL2L1/Bcl-2-like protein 1 | Human | E.coli | 840 | 2520 |
| CF02 | BCL2L4/Bax | Human | E.coli | 1200 | 3520 |
| C105 | Bcl-w/Bcl-2-like protein 2 | Human | E.coli | 640 | 2000 |
| CB90 | BCM1/BLAST1/CD48/SLAMF2 | Human | Human cells | 760 | 2000 |
| C962 | BCMO1/β-carotene dioxygenase 1 | Human | Human cells | 1200 | 3520 |
| C125 | B-Defensin 1 | Human | E.coli | 840 | 2520 |
| C126 | B-Defensin 4 | Human | E.coli | 840 | 2520 |
| C127 | B-Defensin 4A | Human | E.coli | 640 | 1760 |
| CF08 | BDH1/D-β-hydroxybutyrate dehydrogenase | Human | E.coli | 1200 | 3520 |
| CE05 | BDH2/DHRS6 | Human | E.coli | 1200 | 3520 |
| C077 | BDNF(with pro peptide) | Human | E.coli | 840 | 2520 |
| C076 | BDNF/Brain-derived neurotrophic factor | Human | E.coli | 1200 | 3520 |
| C747 | Betacellulin/Btc | Mouse | E.coli | 840 | 2520 |
| CP71 | Beta-galactosidase(M443L, C500S) | E.coli | E.coli | 600 | 1200 |
| CH85 | Beta-Glucuronidase/Uida/Beta-Gus | E.coli | E.coli | 840 | 2520 |
| CI51 | beta-NGF/β-Nerve Growth Factor/β-NGF | Human | Human cells | 240 | 720 |
| CK21 | beta-NGF/β-Nerve Growth Factor/β-NGF | Mouse | E.coli | 560 | 1680 |
| C793 | beta-NGF/β-Nerve Growth Factor/β-NGF(131-239) | Mouse | E.coli | 400 | 840 |
| CH21 | Betatrophin/C19orf80/TD26 | Human | E.coli | 1200 | 3520 |
| CC05 | BEX3/NGFRAP1 | Human | Human cells | 1200 | 3520 |
| C106 | BID/BH3-interacting domain death agonist | Human | E.coli | 640 | 2000 |
| C386 | Biglycan | Human | Human cells | 840 | 2520 |
| CK04 | Biliverdin Reductase A/BLVRA | Human | E.coli | 840 | 2520 |
| CF39 | Bisphosphoglycerate mutase/BPGM | Human | E.coli | 760 | 2280 |
| C138 | BLBP/Brain Lipid-Binding Protein | Human | E.coli | 840 | 2520 |
| CE25 | BLNK/BASH/ SLP65 | Human | E.coli | 1200 | 3520 |
| CA37 | BMP-1/PCP | Human | Human cells | 1200 | 3520 |
| C012 | BMP-2 | Human | E.coli | 1200 | 3520 |
| CK38 | BMP-9/GDF2 | Human | Human cells | 1200 | 3520 |
| CD59 | BMPR1A/BMPR-IA/ALK-3(Fc fusion) | Human | Human cells | 400 | 1200 |
| C303 | BMPR-II | Human | Human cells | 400 | 1200 |
| CD22 | BMPR-II/PPH1(Fc fusion) | Human | Human cells | 400 | 1200 |
| CF87 | BNIP3/NIP3 | Human | E.coli | 1200 | 3520 |
| C764 | BOC protein/BOC | Human | Human cells | 760 | 2000 |
| C818 | Bone Marrow Proteoglycan/Bmpg | Human | Human cells | 1200 | 3520 |
| CA75 | Bone marrow stromal antigen 2/BST2 | Human | Human cells | 840 | 2520 |
| CM29 | Brain Natriuretic Peptide/BNP | Human | E.coli | 840 | 2520 |
| C431 | Brain-specific angiogenesis inhibitor 3/BAI3 | Human | Human cells | 840 | 2520 |
| CA73 | Brevican core protein/BCAN | Human | Human cells | 840 | 2520 |
| CE47 | Bridging integrator 2/BIN2/BRAP1 | Human | E.coli | 1200 | 3520 |
| C563 | BTLA/B- and T-lymphocyte attenuator/CD272 | Human | Human cells | 560 | 1680 |
| CD06 | BTLA/B-andT-lymphocyte attenuator/CD272(Fc fusion) | Human | Human cells | 1200 | 3520 |
| C210 | BUP-1/UPB1/β-ureidopropionase | Human | E.coli | 1200 | 3520 |
| CS10 | Butyrophilin Subfamily 1 Member A1/BTN1A1 | Mouse | Human Cells | 760 | 2000 |
| CC91 | Butyrophilin subfamily 3 member A2/BTN3A2 | Human | Human cells | 1200 | 3520 |
| CC72 | Butyrophilin subfamily 3 member A3/BTN3A3 | Human | Human cells | 760 | 2000 |
| C514 | Butyrophilin/BTN | Human | Human cells | 840 | 2520 |
| C560 | Butyrylcholinesterase/BCHE | Human | Human cells | 1200 | 3520 |
| C791 | C10orf54/platelet receptor Gi24 | Human | Human cells | 400 | 1200 |
| C405 | C1q R1/CD93 | Human | Human cells | 840 | 2520 |
| CF70 | C1qBP/HABP1 | Human | E.coli | 760 | 2000 |
| C304 | C1qTNF1/CTRP1 | Human | Human cells | 840 | 2520 |
| C855 | C1qTNF9 | Human | Human cells | 1200 | 3520 |
| CI20 | C2orf7/PRADC1 | Human | Human cells | 1200 | 3520 |
| C075 | C5a/Complement Component C5 | Mouse | E.coli | 1080 | 3200 |
| CM85 | Cadherin-1/E-Cadherin/CDH1 | Human | Human Cells | 480 | 1200 |
| CA45 | Cadherin-11/CDH11 | Human | Human cells | 840 | 2520 |
| CB83 | Cadherin-11/CDH11(Fc fusion) | Human | Human cells | 760 | 2000 |
| CA12 | Cadherin-17/CDH17 | Human | Human cells | 1200 | 3520 |
| C968 | Cadherin-3/CDH3 | Human | Human Cells | 1440 | 4320 |
| CK97 | Cadherin-3/P-Cadherin/CDH3 | Mouse | Human Cells | 600 | 1440 |
| CD39 | Cadherin-6/CDH6(Fc fusion) | Human | Human cells | 760 | 2000 |
| C434 | Cadherin-6/KCAD/CDH6 | Human | Human cells | 640 | 1760 |
| CA10 | Cadherin-8/CDH8 | Human | Human cells | 1200 | 3520 |
| C582 | Cadherin-9/CDH-9 | Human | Human cells | 840 | 2520 |
| CE42 | Calcineurin Subunit B Type 1/CNB/PPP3R1 | Human | E.coli | 1200 | 3520 |
| CH09 | Calcitonin gene-related peptide 2/CALCB/CALC2 | Human | E.coli | 360 | 840 |
| CA21 | Calcitonin/CALCA/CALC1 | Human | Human cells | 1200 | 3520 |
| CG52 | Calcitonin/CALCA/CALC1 | Human | E.coli | 840 | 2520 |
| C936 | Calmegin/CLGN | Human | Human cells | 1200 | 3520 |
| C566 | Calnexin/IP90/CANX | Human | Human cells | 840 | 2520 |
| CG02 | Calpain-2 catalytic subunit/CAPN2/CANPL2 | Human | E.coli | 1200 | 3520 |
| CG66 | calreticulin-3/CALR3/CRT2 | Human | E.coli | 760 | 2280 |
| CA43 | Calumenin/CALU | Human | Human cells | 840 | 2520 |
| C937 | CAMK1/CaM kinase I | Human | Human cells | 840 | 2520 |
| CG94 | CAMK1D/Calcium/calmodulin-dependent protein kinase type 1D | Human | E.coli | 1200 | 3520 |
| CF55 | CAMK2B | Human | E.coli | 1200 | 3520 |
| C332 | CAR/NR1I3 | Human | Human cells | 640 | 1760 |
| CK69 | Carbonic Anhydrase 12/CA12 | Mouse | Human Cells | 1200 | 3520 |
| C107 | Carbonic Anhydrase I/CA1 | Human | E.coli | 480 | 1440 |
| CF26 | Carbonic Anhydrase III/CA3 | Human | E.coli | 760 | 2280 |
| C109 | Carbonic Anhydrase IV/CA4 | Human | E.coli | 1200 | 3520 |
| C110 | Carbonic Anhydrase VB/CA5B | Human | E.coli | 1200 | 3520 |
| C111 | Carbonic Anhydrase VII/CA7 | Human | E.coli | 480 | 1440 |
| C112 | Carbonic Anhydrase VIII/CA8 | Human | E.coli | 480 | 1440 |
| C305 | Carbonic Anhydrase X/CA10 | Human | Human cells | 1200 | 3520 |
| CE99 | Carbonic Anhydrase X/CA10 | Human | E.coli | 840 | 2520 |
| C108 | Carbonic Anhydrase XIII/CA13 | Human | E.coli | 480 | 1440 |
| CJ84 | Carbonic Anhydrase XIV/CA14 | Mouse | Human cells | 1200 | 3520 |
| CK26 | Carbonic Anhydrase XIV/CA14 | Mouse | E.coli | 760 | 2280 |
| CG12 | Carbonic anhydrase XIV/CA14(N-polyHis) | Human | E.coli | 1200 | 3520 |
| C823 | Carbonic anhydrase-related protein XI/CA11 | Human | Human cells | 1200 | 3520 |
| C450 | Carboxylesterase 1/CES1 | Human | Human cells | 1200 | 3520 |
| CK45 | Carboxylesterase 5/CES5 | Mouse | Human cells | 1200 | 3520 |
| C592 | Carboxypeptidase A1/CPA1 | Human | Human cells | 1200 | 3520 |
| C593 | Carboxypeptidase A2/CPA2 | Human | Human cells | 1200 | 3520 |
| C594 | Carboxypeptidase A4/CPA4 | Human | Human cells | 1200 | 3520 |
| C455 | Carboxypeptidase B1/CPB1 | Human | Human cells | 1200 | 3520 |
| CA32 | Carboxypeptidase B2/CPB2 | Human | Human cells | 840 | 2520 |
| CC57 | Carboxypeptidase E/CPE | Human | Human cells | 1200 | 3520 |
| C780 | carboxypeptidase M/CPM | Mouse | Human cells | 400 | 840 |
| CC58 | Carboxypeptidase M/CPM | Human | Human cells | 1200 | 3520 |
| CH05 | Cardiotrophin-1/CTF1 | Human | E.coli | 1200 | 3520 |
| C436 | Carnosine Dipeptidase 1/CNDP1 | Human | Human cells | 1200 | 3520 |
| CA65 | CART/CARTPT | Human | Human cells | 840 | 2520 |
| CG70 | Casein kinase I isoform gamma-2/CSNK1G2 | Human | E.coli | 760 | 2280 |
| CI41 | CASK/Peripheral plasma membrane protein CASK |
Human | Human cells | 840 | 2520 |
| CF93 | Caspase-10/CASP10 | Human | E.coli | 1200 | 3520 |
| CG19 | Caspase-14/CASP14 | Human | E.coli | 1200 | 3520 |
| CE86 | Catalase/CAT | Human | E.coli | 1200 | 3520 |
| CI11 | cathepsin A/CTSA | Human | Human cells | 1200 | 3520 |
| C398 | Cathepsin B/CTSB | Human | Human cells | 1200 | 3520 |
| CJ65 | Cathepsin B/CTSB | Mouse | Human cells | 1200 | 3520 |
| C399 | Cathepsin D | Human | Human cells | 1200 | 3520 |
| CC21 | Cathepsin D | Mouse | Human cells | 1200 | 3520 |
| C400 | Cathepsin E | Human | Human cells | 1200 | 3520 |
| CD28 | Cathepsin E/CTSE | Mouse | Human cells | 1200 | 3520 |
| CK47 | Cathepsin H/CTSH | Mouse | Human cells | 1200 | 3520 |
| CD24 | Cathepsin L/CTSL1 | Mouse | Human cells | 1200 | 3520 |
| C401 | Cathepsin L1 | Human | Human cells | 1200 | 3520 |
| C460 | Cathepsin L2 | Human | Human cells | 1200 | 3520 |
| C402 | Cathepsin S | Human | Human cells | 1200 | 3520 |
| CM37 | Cathepsin S/CTSS | Mouse | Human Cells | 1200 | 3520 |
| C438 | Cathepsin X/Z/P | Human | Human cells | 1200 | 3520 |
| CS16 | C-C motif chemokine 2/CCL2 | Mouse | Human cells | 1200 | 3520 |
| CR09 | C-C motif chemokine 2/CCL2 | Mouse | E.coli | 1200 | 3520 |
| CM78 | C-C Motif Chemokine 2/CCL2/MCP-1 | Human | E.coli | 1200 | 3520 |
| C696 | C-C motif chemokine 24/CCL24 | Mouse | E.coli | 840 | 2520 |
| CR13 | C-C Motif Chemokine 3/CCL3/MIP-1a | Mouse | E.coli | 1200 | 3520 |
| CJ28 | C-C motif chemokine 5/CCL5 | Human | Human cells | 1200 | 3520 |
| CS45 | C-C motif Chemokine 8/CCL8/MCP-2 | Mouse | Human Cells | 1200 | 3520 |
| CI22 | CCDC134/Coiled-coil domain-containing protein 134 | Human | Human cells | 760 | 2000 |
| C094 | CCL1/I-309/TCA-3 | Human | E.coli | 1200 | 3520 |
| CF47 | CCL11/Eotaxin | Human | E.coli | 760 | 2280 |
| C439 | CCL14/HCC-1/HCC-3 | Human | Human cells | 840 | 2520 |
| C064 | CCL16/HCC-4 | Human | E.coli | 936 | 2800 |
| CF38 | CCL18/PARC | Human | E.coli | 1200 | 3520 |
| CG27 | CCL21/6Ckine | Mouse | E.coli | 760 | 2280 |
| C090 | CCL23/Ck beta 8-1 | Human | E.coli | 936 | 2800 |
| CC43 | CCL24/Eotaxin-2/MPIF-2 | Human | Human cells | 760 | 2280 |
| C113 | CCL26/Eotaxin-3(24-94) | Human | E.coli | 936 | 2800 |
| C114 | CCL26/Eotaxin-3(27-94) | Human | E.coli | 1024 | 3080 |
| C065 | CCL27/CTACK | Human | E.coli | 936 | 2800 |
| C095 | CCL28 | Human | E.coli | 936 | 2800 |
| C061 | CCL3/MIP-1 alpha | Human | E.coli | 936 | 2800 |
| C515 | CCL3L1/MIP-1 alpha Isoform LD78 beta | Human | Human cells | 1200 | 3520 |
| C062 | CCL5/RANTES | Human | E.coli | 936 | 2800 |
| C063 | CCL8/MCP-2 | Human | E.coli | 1200 | 3520 |
| CC95 | CCL8/MCP-2 | Human | Human cells | 760 | 2280 |
| CH06 | CCL9/C-C motif chemokine 9 | Mouse | E.coli | 840 | 2520 |
| CH94 | CCND2/G1/S-specific cyclin-D2 | Human | E.coli | 840 | 2520 |
| CC80 | CD100/Semaphorin 4D | Human | Human cells | 760 | 2280 |
| C306 | CD102/ICAM-2 | Human | Human cells | 400 | 1200 |
| CG65 | CD105/Endoglin | Human | E.coli | 840 | 2520 |
| C307 | CD106/VCAM-1/L1CAM | Human | Human cells | 400 | 1200 |
| C482 | CD107a/LAMP1 | Human | Human cells | 640 | 1760 |
| CD15 | CD107a/LAMP1(Fc fusion) | Human | Human cells | 760 | 2000 |
| C440 | CD112/Nectin-2 | Human | Human cells | 640 | 1760 |
| CJ06 | CD112/nectin2/Pvrl2/Pvr/Mph/Pvs | Mouse | Human cells | 400 | 1200 |
| C630 | CD113/Nectin-3/PVRL3 | Human | Human cells | 640 | 1760 |
| CA23 | CD116/GM-CSF-R-alpha/CSF2RA | Human | Human cells | 720 | 2000 |
| CG50 | CD120a/TNFRSF1A/P55/P60 | Mouse | E.coli | 760 | 2000 |
| CJ82 | CD122/IL-2RB/Interleukin-2 receptor subunit beta(Fc fusion) | Human | Human cells | 1200 | 3520 |
| CI03 | CD127/IL-7R | Human | Human cells | 760 | 2000 |
| CB64 | CD132/IL-2RG | Human | Human cells | 720 | 2000 |
| CA71 | CD138/Syndecan-1 | Human | Human cells | 1200 | 2520 |
| C308 | CD14 | Human | Human cells | 640 | 1760 |
| C479 | CD142/Tissue factor/F3 | Human | Human cells | 1200 | 3520 |
| C309 | CD150/SLAM | Human | Human cells | 560 | 1680 |
| CI56 | CD154/CD40L/TNFSF5 | Human | Human cells | 760 | 2000 |
| C622 | CD155/PVR | Human | Human cells | 840 | 2520 |
| C310 | CD158d/KIR2DL4 | Human | Human cells | 640 | 1760 |
| CA35 | CD160/NK receptor BY55 | Human | Human cells | 400 | 1120 |
| CD92 | CD162/SELPLG/P-selectin glycoprotein ligand 1 | Mouse | Human cells | 760 | 2000 |
| CS49 | CD166 Antigen | Human | Human cells | 240 | 720 |
| C441 | CD16a/Fc gamma RIIIA | Human | Human cells | 640 | 1760 |
| CB85 | CD16b/Fc gamma RIIIB | Human | Human cells | 760 | 2000 |
| C385 | CD172a/SIRPA/Signal-Regulatory Protein α | Human | Human cells | 560 | 1680 |
| C442 | CD177/PRV1 | Human | Human cells | 840 | 2520 |
| C572 | CD19 | Human | Human cells | 840 | 2520 |
| CC99 | CD2/LFA-3 receptor | Human | Human cells | 1200 | 3520 |
| C312 | CD200 R1 | Human | Human cells | 640 | 1760 |
| CD26 | CD200 R1(Fc fusion) | Human | Human cells | 1200 | 3520 |
| C311 | CD200/OX-2 | Human | Human cells | 640 | 1760 |
| CD37 | CD200/OX-2/MOX1/MOX2(Fc fusion) | Human | Human cells | 760 | 2000 |
| C769 | CD209 antigen/CD209 | Human | Human cells | 760 | 2000 |
| CI53 | CD217/IL-17RA | Human | Human cells | 400 | 1200 |
| C164 | CD230/Major prion protein/PrP | Human | E.coli | 840 | 2520 |
| CJ78 | CD25/IL2-RA/IL-2 receptor subunit alpha(Fc fusion) | Human | Human cells | 720 | 2000 |
| CD31 | CD262/TNFRSF10B/TRAILR2/DR5 | Human | Human cells | 400 | 1200 |
| CD17 | CD263/TNFRSF10C/TRAILR3/TRID | Human | Human cells | 400 | 1200 |
| CD27 | CD266/TNFRSF12A | Human | Human cells | 760 | 2000 |
| CD75 | CD266/TNFRSF12A/Fn14/TWEAKR | Mouse | Human cells | 760 | 2000 |
| CP48 | CD27/TNFRSF7 | Mouse | Human Cells | 400 | 1200 |
| CD60 | CD27/TNFRSF7(Fc fusion) | Human | Human cells | 320 | 960 |
| CD81 | CD28/TP44 | Human | Human cells | 240 | 640 |
| CD41 | CD300A/CMRF35-like molecule 8/CMRF35H/IGSF12 | Human | Human cells | 760 | 2000 |
| CD16 | CD300C/CMRF35-like molecule 6/CMRF35/IGSF16 | Human | Human cells | 760 | 2000 |
| C587 | CD301/CLEC10A | Human | Human cells | 640 | 1760 |
| C607 | CD307a/FCRL1/FcRH1 | Human | Human cells | 640 | 1760 |
| C948 | CD316/IGSF8 | Human | Human cells | 840 | 2520 |
| C316 | CD319/CRACC/SLAMF7 | Human | Human cells | 560 | 1680 |
| C444 | CD32/Fc-gamma RII-b | Human | Human cells | 640 | 1760 |
| CD62 | CD320/FDC-signaling molecule 8D6(Fc fusion) | Human | Human cells | 760 | 2000 |
| CC01 | CD320/TCblR/8D6A | Human | Human cells | 760 | 2000 |
| C318 | CD32a/Fc gamma RII | Human | Human cells | 640 | 1760 |
| C445 | CD33/Siglec-3 | Human | Human cells | 640 | 1760 |
| CJ10 | CD33/Siglec-3/Siglec3 |
Mouse | Human cells | 840 | 2520 |
| CG15 | CD337/NKp30/NCR3 | Human | Human cells | 1200 | 3520 |
| CH03 | CD340/Erbb2 | Rat | E.coli | 760 | 2000 |
| CD68 | CD340/ERBB2/HER2 | Human | Human cells | 760 | 2000 |
| CD84 | CD352/SLAM family member 6/Slamf6 | Mouse | Human cells | 760 | 2000 |
| CD76 | CD357/GITR/TNFRSF18 | Mouse | Human cells | 720 | 2000 |
| C327 | CD358/DR6/TNFRSF21 | Human | Human cells | 320 | 960 |
| CD79 | CD358/DR6/TNFRSF21 | Mouse | Human cells | 760 | 2000 |
| C578 | CD3E/T-cell surface glycoprotein CD3 epsilon chain | Human | Human cells | 840 | 2520 |
| CP19 | CD3ε/CD3E (C-Fc) | Human | Human Cells | 760 | 2000 |
| C579 | CD4+/CD62L-/CD44 | Human | Human cells | 640 | 1760 |
| C011 | CD40 Ligand/TNFSF5 | Human | E.coli | 400 | 1120 |
| C319 | CD40/TNFRSF5 | Human | Human cells | 400 | 1120 |
| CD12 | CD40/TNFRSF5(Fc fusion) | Human | Human cells | 760 | 2000 |
| CM09 | CD40/TNFRSF5/CD40L Receptor | Mouse | Human Cells | 600 | 1440 |
| CD13 | CD44/LHR/MDU2/MDU3/MIC4 | Human | Human cells | 760 | 2000 |
| C320 | CD46 | Human | Human cells | 840 | 2520 |
| C321 | CD47/IAP | Human | Human cells | 640 | 1760 |
| CG18 | CD47/IAP(Fc fusion) | Human | Human cells | 1200 | 3520 |
| C781 | CD5 antigen-like/CD5L | Mouse | Human cells | 760 | 2000 |
| CK65 | CD5/Leu-1 | Mouse | Human Cells | 760 | 2000 |
| C322 | CD54/ICAM-1 | Human | Human cells | 640 | 1760 |
| CD35 | CD54/ICAM1(Fc fusion) | Human | Human cells | 760 | 2000 |
| C323 | CD55/DAF | Human | Human cells | 640 | 1760 |
| C580 | CD5L | Human | Human cells | 640 | 1760 |
| CB50 | CD62E/E-Selectin | Human | Human cells | 760 | 1440 |
| C448 | CD66a/CEACAM1 | Human | Human cells | 640 | 1760 |
| C583 | CD66b/CEACAM8 | Human | Human cells | 840 | 2520 |
| C449 | CD66d/CEACAM3 | Human | Human cells | 840 | 2520 |
| CC66 | CD66f/PSG1/Pregnancy-specific glycoprotein 1 | Human | Human cells | 1200 | 3520 |
| C516 | CD7/GP40 | Human | Human cells | 840 | 2520 |
| CI06 | CD70/TNFSF7 | Human | Human cells | 760 | 2000 |
| CF13 | CD72/Lyb-2 | Human | E.coli | 1200 | 3520 |
| CJ51 | CD74/ H-2 class II histocompatibility antigen gamma chain | Mouse | Human cells | 720 | 2000 |
| CA29 | CD79B/B29 | Human | Human cells | 1200 | 3520 |
| C403 | CD83/HB15 | Human | Human cells | 640 | 1760 |
| CM53 | CD83/HB15 | Mouse | Human Cells | 600 | 1440 |
| CD40 | CD83/HB15(Fc fusion) | Human | Human cells | 760 | 2000 |
| CM01 | CD83/HB15(Fc fusion) | Mouse | Human Cells | 600 | 1440 |
| CC83 | CD85e/ILT6 | Human | Human cells | 760 | 2280 |
| CA47 | CD85h/ILT1 | Human | Human cells | 840 | 2520 |
| C469 | CD89/FCAR | Human | Human cells | 640 | 1760 |
| C581 | CD8B/CD8 β/T-cell surface glycoprotein CD8 beta chain | Human | Human cells | 840 | 2520 |
| CB72 | CD95/Fas/TNFRSF6 | Human | Human cells | 760 | 2000 |
| CD46 | CD95/TNFRSF6/FAS | Human | Human cells | 760 | 2280 |
| C540 | CD98/SLC3A2/MDU1 | Human | Human cells | 840 | 2520 |
| CA67 | CD99 antigen-like protein 2/CD99L2 | Human | Human cells | 840 | 2520 |
| CI75 | CD99 antigen-like protein 2/CD99L2(Fc fusion) | Human | Human cells | 760 | 2000 |
| C447 | CD99/MIC2/MIC2X/MIC2Y | Human | Human cells | 640 | 1760 |
| CD09 | CD99/MIC2/MIC2X/MIC2Y(Fc fusion) | Human | Human cells | 760 | 2000 |
| CE45 | CDC73/Parafibromin | Human | E.coli | 840 | 2520 |
| CI80 | CDCP1/CD318/CUB domain-containing protein 1 | Human | Human cells | 840 | 2520 |
| CJ16 | CDH16/Cadherin-16/Kidney-specific cadherin | Human | Human cells | 840 | 2520 |
| C211 | CDK2 | Human | E.coli | 1200 | 3520 |
| C977 | CDK2AP1/CDKAP1/DOC1 | Human | Human cells | 1200 | 3520 |
| CF12 | CDK4/Cyclin-dependent kinase 4 | Human | E.coli | 840 | 2520 |
| CF11 | CDK6/Cyclin-dependent kinase 6 | Human | E.coli | 840 | 2520 |
| C842 | CDK7/Cyclin-dependent kinase 7 | Human | E.coli | 1200 | 3520 |
| CD01 | CDNF/Cerebral dopamine neurotrophic factor | Human | Human cells | 760 | 2000 |
| CE18 | CDO1/Cysteine dioxygenase type 1 | Human | E.coli | 400 | 1120 |
| CC88 | CEACAM21 | Human | Human cells | 1200 | 3520 |
| CM95 | CEACAM5/CD66e/CEA | Human | Human cells | 760 | 2000 |
| CP16 | CEACAM5/CD66e/CEA(Fc fusion) | Human | Human Cells | 760 | 2000 |
| C926 | CEACAM7/Carcinoembryonic antigen CGM2 | Human | Human cells | 1200 | 3520 |
| C759 | Cell adhesion molecule 1/CADM1 | Mouse | Human cells | 760 | 2000 |
| C584 | Cerberus 1/CER1 | Human | Human cells | 1024 | 3080 |
| CK39 | CES3/Carboxylesterase-3/CES1D | Mouse | Human cells | 1200 | 3520 |
| C517 | CFHR2/Complement Factor H-related 2 | Human | Human cells | 840 | 2520 |
| CC93 | CGB5/Choriogonadotropin subunit beta | Human | Human cells | 1200 | 3520 |
| CA79 | CGR11/CGREF1 | Human | Human cells | 840 | 2520 |
| CE53 | Checkpoint protein HUS1/HUS1 | Human | E.coli | 840 | 2520 |
| C452 | Chitinase-3-like protein 1/CHI3L1 | Human | Human cells | 640 | 1760 |
| C586 | Chitinase-3-like protein 2/CHI3L2 | Human | Human cells | 840 | 2520 |
| C451 | Chitotriosidase/CHIT1 | Human | Human cells | 1200 | 3520 |
| CM68 | Chlorite Dismutase | Dechloromonas aromatica | E.coli | 840 | 2520 |
| CA04 | Chondroadherin/CHAD | Human | Human cells | 840 | 2520 |
| CK70 | Chordin-like protein 2/CHL2/CHRDL2 | Mouse | Human Cells | 760 | 2000 |
| CI32 | CHRNB3/Neuronal acetylcholine receptor subunit beta-3 | Human | Human cells | 840 | 2520 |
| C518 | Chymotrypsin C/CTRC | Human | Human cells | 1200 | 3520 |
| C458 | Chymotrypsin-like protease CTRL-1 | Human | Human cells | 840 | 2520 |
| C490 | Chymotrypsinogen B/CTRB1 | Human | Human cells | 840 | 2520 |
| C034 | c-kit Ligand/SCF/KITLG | Human | E.coli | 1200 | 3520 |
| C453 | CLEC3B/Tetranectin | Human | Human cells | 640 | 1760 |
| CS20 | CLEC4E/Mincel | Human | Human Cells | 760 | 2000 |
| CG13 | CLIC1/Chloride intracellular channel protein 1 | Human | E.coli | 760 | 2000 |
| C266 | CLIC2/XAP121 | Human | E.coli | 1200 | 3520 |
| CG59 | CLIC3/Chloride intracellular channel protein 3 | Human | E.coli | 1200 | 3520 |
| CE14 | CLIC4/Chloride intracellular channel protein 4 | Human | E.coli | 1200 | 3520 |
| C212 | CLIC5/Chloride intracellular channel protein 5 | Human | E.coli | 1200 | 3520 |
| CA57 | CL-K1/COLEC11 | Human | Human cells | 720 | 2000 |
| CI14 | Clusterin/CLU | Mouse | Human cells | 760 | 2000 |
| C454 | Clusterin/CLU/APOJ/CLI/KUB1 | Human | Human cells | 640 | 1760 |
| CA55 | Clusterin-like 1/CLUL1 | Human | Human cells | 1200 | 3520 |
| C576 | Cmrf35-Like Molecule 9/Clm-9 | Human | Human cells | 840 | 2520 |
| CJ14 | CNDP2/CN2 /CPGL | Mouse | Human cells | 840 | 2520 |
| C098 | CNTF/Ciliary neurotrophic factor | Human | E.coli | 936 | 2800 |
| CJ04 | Coagulation factor X/Stuart factor/F10 | Mouse | Human cells | 1200 | 3520 |
| CI16 | COL3A1/Collagen alpha-1(III) chain | Mouse | Human cells | 1200 | 3520 |
| C940 | COL8A1/Collagen alpha-1(VIII) chain | Human | Human cells | 1200 | 3520 |
| CI29 | COL9A1/Collagen alpha-1(IX) chain | Human | Human cells | 400 | 1200 |
| CM99 | Complement Component C3a/C3a | Cynomolgus monkey | Human cells | 840 | 2520 |
| CP21 | Complement Component C3a/C3a | Human | E.coli | 840 | 2520 |
| CH44 | Complement component C8 gamma chain/C8G | Human | E.coli | 840 | 2520 |
| C329 | Complement Factor B | Human | Human cells | 840 | 2520 |
| CP03 | Complement Factor D/Adipsin | Cynomolgus monkey | Human cells | 1200 | 3520 |
| CP27 | Complement Factor D/Adipsin | Human | Human Cells | 1200 | 3520 |
| CI77 | Complement factor H/CFH | Human | Human cells | 1200 | 3520 |
| C585 | Complement Factor H-related 1/CFHR1 | Human | Human cells | 840 | 2520 |
| CC74 | Complement Factor H-related 5/CFHR5 | Human | Human cells | 760 | 2000 |
| CM22 | Connective Tissue Growth Factor/CTGF/CCN2 | Human | Human Cells | 840 | 2520 |
| CJ24 | Contactin-2/CNTN2 | Human | Human cells | 840 | 2520 |
| CG87 | Copine-1/CPNE1 | Human | E.coli | 760 | 2280 |
| C590 | Corneodesmosin/CDSN | Human | Human cells | 560 | 1680 |
| C117 | Cornulin | Human | E.coli | 840 | 2520 |
| CK18 | Coronin-6 | Human | E.coli | 1200 | 3520 |
| C595 | Corticotropin-releasing factor-binding protein/CRHBP | Human | Human cells | 840 | 2520 |
| CJ17 | CPA2/Carboxypeptidase A2 | Mouse | Human cells | 840 | 2520 |
| CJ13 | CPA4/Carboxypeptidase A4 | Mouse | Human cells | 1200 | 3520 |
| CF64 | CRADD/CAIDD | Human | E.coli | 1200 | 3520 |
| C213 | C-Reactive Protein/CRP | Human | E.coli | 160 | 400 |
| CC96 | Creatine Kinase, Muscle/CKMM | Human | Human cells | 360 | 840 |
| CF01 | CRYAA/Alpha-crystallin A chain | Human | E.coli | 240 | 720 |
| C118 | CRYAB/Alpha-crystallin B chain | Human | E.coli | 840 | 2520 |
| CI99 | Cryptic protein/cryptic | Human | Human cells | 760 | 2000 |
| CH35 | CSN2/Beta-casein/CASB | Human | E.coli | 1200 | 3520 |
| CI07 | CTGF/Connective tissue growth factor/IGFBP8 | Human | Human cells | 1200 | 3520 |
| CC98 | CTHRC1/Collagen triple helix repeat-containing protein 1 | Human | Human cells | 1200 | 3520 |
| CH92 | CTLA-4 | Cavia porcellus | P.Pichia | 1200 | 3520 |
| CK46 | CTNNB1/beta-Catenin | Mouse | Human cells | 1200 | 3520 |
| CA28 | CTSH/Pro-cathepsin H | Human | Human cells | 1200 | 3520 |
| C588 | C-Type Lectin Domain Family 4 Member E/CLEC4E | Human | Human cells | 840 | 2520 |
| CR10 | Cutinase(C-6xHis) | Thermobifida fusca | E.coli | 1200 | 3520 |
| C461 | CX3CL1/Fractalkine | Human | Human cells | 936 | 2800 |
| CI38 | CX3CL1/Fractalkine | Mouse | Human cells | 760 | 2000 |
| C786 | C-X-C motif chemokine 1/CXCL1 | Mouse | Human cells | 840 | 2520 |
| CR14 | C-X-C Motif Chemokine 9/CXCL9 | Mouse | E.coli | 1200 | 3520 |
| C597 | CXCL1/GRO | Human | Human cells | 640 | 1760 |
| CD32 | CXCL10/INP10/SCYB10(Fc fusion) | Human | Human cells | 760 | 2280 |
| C054 | CXCL10/IP-10/CRG-2 | Human | E.coli | 640 | 2000 |
| C119 | CXCL11/I-TAC | Human | E.coli | 936 | 2800 |
| C120 | CXCL12/SDF-1(19-93) | Human | E.coli | 1200 | 3520 |
| C121 | CXCL12/SDF-1(22-89) | Human | E.coli | 1200 | 3520 |
| C122 | CXCL12/SDF-1(22-93) | Human | E.coli | 1200 | 3520 |
| C058 | CXCL14/BRAK | Human | E.coli | 936 | 2800 |
| CJ85 | CXCL15/Lungkine | Mouse | Human cells | 1200 | 3520 |
| CC44 | CXCL16/SR-PSOX | Mouse | Human cells | 840 | 2520 |
| C096 | CXCL2/GRO beta/MIP-2/CINC-3 | Human | E.coli | 1200 | 3520 |
| CE97 | CXCL3/GRO gamma/CINC-2/DCIP-1 | Human | E.coli | 840 | 2520 |
| C055 | CXCL4/PF4 | Human | E.coli | 936 | 2800 |
| CJ27 | CXCL4/Platelet factor 4 | Human | Human cells | 840 | 2520 |
| CF14 | CXCL5/ENA-70 | Human | E.coli | 760 | 2280 |
| C598 | CXCL6/GCP-2 | Human | Human cells | 1200 | 3520 |
| C056 | CXCL7/NAP-2 | Human | E.coli | 1200 | 3520 |
| CI83 | CXCL7/PPBP | Human | Human cells | 400 | 1200 |
| CC97 | CXCL8/IL-8 | Human | Human cells | 760 | 2280 |
| C037 | CXCL8/IL-8 (3-79) | Human | E.coli | 800 | 2320 |
| C035 | CXCL8/IL-8 (8-79) | Human | E.coli | 800 | 2400 |
| C437 | CXCL9/MIG | Human | Human cells | 936 | 2800 |
| C785 | Cyclin-dependent kinase 2-associated protein 2/CDK2AP2 | Human | Human cells | 400 | 840 |
| C243 | Cyclin-dependent kinase 4 inhibitor C/p18-INK4c/CDKN2C | Human | E.coli | 1200 | 3520 |
| CH95 | Cyclin-H/CCNH | Human | E.coli | 840 | 2520 |
| C215 | Cyclophilin C/CYPC | Human | E.coli | 1200 | 3520 |
| C216 | Cyclophilin E/PPIase E/CYP33 | Human | E.coli | 1200 | 3520 |
| CB98 | Cyr61/CCN1 | Human | Human cells | 760 | 2000 |
| CF60 | Cystathionine gamma-lyase/CTH | Human | E.coli | 760 | 2280 |
| CR02 | Cystatin 8/CST8 | Mouse | E.coli | 1200 | 3520 |
| C087 | Cystatin A | Human | E.coli | 640 | 1760 |
| CE75 | Cystatin C/CST3 | Human | E.coli | 840 | 2520 |
| CR17 | Cystatin C/CST3 | Human | E.coli | 1200 | 3520 |
| CS25 | Cystatin C/CST3 | Human | Human Cells | 1200 | 3520 |
| CI55 | Cystatin C/CST3 (C-6His) | Human | Human cells | 1200 | 3520 |
| C397 | Cystatin D | Human | Human cells | 1200 | 3520 |
| C333 | Cystatin E/Cystatin M/CST6 | Human | Human cells | 1200 | 3520 |
| CD44 | Cystatin E/M/CST6 | Mouse | Human cells | 1200 | 3520 |
| C334 | Cystatin F/CST7 | Human | Human cells | 1200 | 3520 |
| CD20 | Cystatin F/CST7 | Mouse | Human cells | 840 | 2520 |
| C335 | Cystatin S/CST4/Cystatin-4 | Human | Human cells | 640 | 1760 |
| C336 | Cystatin SA/CST2/Cystatin-2 | Human | Human cells | 1200 | 3520 |
| C462 | Cystatin SN | Human | Human cells | 1200 | 3520 |
| C330 | Cysteine-rich secretory protein 3/CRISP-3 | Human | Human cells | 640 | 1760 |
| C969 | Cysteine-rich with EGF-like domain protein 2/CRELD2 | Human | Human cells | 1200 | 3520 |
| CJ36 | Cytochrome b5 type B/CYB5B | Human | Human cells | 1200 | 3520 |
| C217 | Cytochrome b5/MCB5/CYB5A | Human | E.coli | 1200 | 3520 |
| CH62 | Cytochrome b-c1 complex subunit /UQCRH | Human | E.coli | 1200 | 3520 |
| CF80 | Cytochrome c/CYCS | Human | E.coli | 1200 | 3520 |
| C124 | Cytoglobin/Histoglobin/HGb | Human | E.coli | 840 | 2520 |
| C331 | Cytotoxic and regulatory T-cell molecule/CRTAM | Human | Human cells | 640 | 1760 |
| CS47 | Cytotoxic T-lymphocyte Protein 4(C-Flag) | Human | Human cells | 240 | 720 |
| CS48 | Cytotoxic T-lymphocyte Protein 4(C-Flag) | Mouse | Human cells | 240 | 720 |
| CS14 | Cytotoxic T-lymphocyte protein 4/CTLA-4(C-Fc) | Mouse | Human cells | 400 | 720 |
| CI31 | Cytotoxic T-lymphocyte protein 4/CTLA4/CD152(C-Fc) | Human | Human cells | 240 | 640 |
| CP33 | Cytotoxic T-Lymphocyte Protein 4/CTLA-4/CD152 (C-6His) | Human | Human Cells | 400 | 960 |
| CP34 | Cytotoxic T-Lymphocyte Protein 4/CTLA-4/CD152 (C-6His) | Mouse | Human Cells | 400 | 960 |
| CE63 | D-amino-acid oxidase/DAO | Human | E.coli | 1200 | 3520 |
| CJ64 | DCBLD2/ESDN/CLCP1 | Human | Human cells | 400 | 1200 |
| C271 | DCN1-like protein 1/DCUN1D1 | Human | E.coli | 1200 | 3520 |
| CM48 | DDR2/CD167/TKT | Mouse | Human Cells | 600 | 1440 |
| CM87 | Decorin/PGS2/PG40 | Mouse | Human cells | 240 | 720 |
| CA26 | Dentin matrix acidic phosphoprotein 1/DMP-1 | Human | Human cells | 400 | 1120 |
| CF06 | Deoxycytidine kinase/DCK | Human | E.coli | 760 | 2280 |
| C129 | Deoxyhypusine synthase/DHS | Human | E.coli | 840 | 2520 |
| CB68 | Dermatopontin/DPT | Human | Human cells | 760 | 2000 |
| CE67 | Desmin/DES | Human | E.coli | 1200 | 3520 |
| CE91 | DFF45/DFFA/ICAD | Human | E.coli | 760 | 2000 |
| CK99 | Dickkopf-Like Protein 1/DkkL1/Soggy-1 | Mouse | Human Cells | 840 | 2520 |
| C688 | Dickkopf-related protein 1/DKK1 | Human | Human cells | 1200 | 3520 |
| C773 | Dickkopf-related protein 1/DKK1 | Mouse | Human cells | 1200 | 3520 |
| C852 | Dihydropteridine reductase/QDPR | Human | Human cells | 840 | 2520 |
| C819 | Dipeptidase 1/DPEP1 | Human | Human cells | 840 | 2520 |
| CH47 | Dipeptidyl peptidase 3/DPP3 | Human | E.coli | 1200 | 3520 |
| CH23 | Disks large homolog 4/DLG4/PSD95 | Human | E.coli | 840 | 2520 |
| CC49 | Dkk-2/Dickkopf-related protein 2 | Human | Human cells | 840 | 2520 |
| C412 | Dkk-3/Dickkopf-related protein 3 | Human | Human cells | 640 | 1760 |
| C159 | DNA Polymerase beta | Human | E.coli | 840 | 2520 |
| CS07 | DNAX Accessory Molecule-1/DNAM-1/CD226 | Mouse | Human Cells | 760 | 2000 |
| C326 | DR5/TRAIL R2/TNFRSF10B | Human | Human cells | 320 | 960 |
| CG09 | DR6/TNFRSF21(Fc fusion) | Human | Human cells | 480 | 1440 |
| CI72 | D-tyrosyl-tRNA(Tyr) deacylase 1/DTD1 | Human | Human cells | 1200 | 3520 |
| C745 | Dual specificity protein phosphatase 3/DUSP3 | Human | E.coli | 760 | 2000 |
| CF33 | dUTPase/DUT | Human | E.coli | 760 | 2280 |
| CF59 | E3 ubiquitin-protein ligase parkin/PARK2/PRKN | Human | E.coli | 840 | 2520 |
| CJ52 | E-Cadherin/CDH1/E-cad/CD324 | Human | Human cells | 1200 | 3520 |
| CK08 | ECH1/Delta(3,5)-Delta(2,4)-dienoyl-CoA isomerase/mitochondrial | Human | E.coli | 840 | 2520 |
| CM44 | Ectodysplasin A2 Receptor/EDA2R/TNFRSF27 (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM43 | Ectodysplasin A2 Receptor/EDA2R/TNFRSF27 (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| CK76 | Ectodysplasin Receptor/EDAR | Mouse | Human Cells | 760 | 2000 |
| CE12 | EDF1/MBF1 | Human | E.coli | 1200 | 3520 |
| CJ23 | EFNB1/Ephrin-B1 | Mouse | Human cells | 240 | 640 |
| C029 | EGF | Human | E.coli | 160 | 400 |
| CH28 | EGF/epidermal growth factor | Mouse | E.coli | 240 | 720 |
| C601 | EGF-like repeats and discoidin I-like domains 3/EDIL3 | Human | Human cells | 640 | 1760 |
| CI61 | EGFR/HER1/ERBB1 | Human | Human cells | 1200 | 3520 |
| CI54 | EGFR/HER1/ERBB1(Fc fusion) | Human | Human cells | 760 | 2000 |
| C954 | EG-VEGF/PK1 | Human | Human cells | 840 | 2520 |
| C219 | EIF1AX | Human | E.coli | 1200 | 3520 |
| C220 | EIF1B | Human | E.coli | 1200 | 3520 |
| CH36 | eIF-4E/Eukaryotic translation initiation factor 4E | Human | E.coli | 1200 | 3520 |
| C200 | EIF4EBP1 | Human | E.coli | 840 | 2520 |
| CE61 | EIF4EBP2 | Human | E.coli | 1200 | 3520 |
| CG95 | EIF5A2/Eukaryotic translation initiation factor 5A-2 | Human | E.coli | 760 | 2280 |
| CA31 | ELA3A/CELA3A/ELA3 | Human | Human cells | 1200 | 3520 |
| CA39 | Elafin/Trappin-2 | Human | Human cells | 1200 | 3520 |
| CG43 | Electron transfer flavoprotein subunit beta /ETFB/FP585 |
Human | E.coli | 840 | 2520 |
| C338 | Endocan/ESM-1 | Human | Human cells | 640 | 1760 |
| CD52 | Endoplasmic reticulum resident protein 44/ERP44/TXNDC4 | Human | Human cells | 760 | 2280 |
| CD29 | Endothelial cell-selective adhesion molecule/ESAM | Human | Human cells | 760 | 2000 |
| CM49 | Endothelial cell-specific molecule /Endocan/ESM-1 | Mouse | Human Cells | 600 | 1440 |
| C340 | Endothelial protein C receptor/EPCR | Human | Human cells | 840 | 2520 |
| C339 | EpCAM/TROP1 | Human | Human cells | 560 | 1680 |
| CM50 | EpCAM/TROP1/CD326 (C-Fc) | Human | Human Cells | 600 | 1440 |
| CI04 | EPDR1/Mammalian ependymin-related protein 1 |
Human | Human cells | 400 | 1200 |
| CK51 | EphA4/Ephrin type-A receptor 4/HEK8 | Human | Human Cells | 720 | 2000 |
| CJ75 | EphA4/Ephrin type-A receptor 4/HEK8/SEK/TYRO1(Fc fusion) | Human | Human cells | 720 | 2000 |
| C519 | EphA7 | Human | Human cells | 720 | 2000 |
| CJ80 | EphA8/Ephrin type-A receptor 8/EEK/HEK3/KIAA1459 | Human | Human cells | 720 | 2000 |
| CD11 | EphB1/Ephrin type-B receptor 1(Fc fusion) | Human | Human cells | 1200 | 3520 |
| CJ73 | EphB2/Ephrin type-B receptor 2 | Human | Human cells | 720 | 2000 |
| CS02 | Ephrin A Receptor 1/EphA1 (C-6His) | Human | Human Cells | 760 | 2000 |
| CS03 | Ephrin A Receptor 2/EphA2 (C-6His) | Human | Human Cells | 400 | 1200 |
| CP37 | Ephrin A Receptor 2/EphA2 (C-Fc) | Human | Human Cells | 760 | 2000 |
| C871 | Ephrin Type-B Receptor 1/Ephb1 | Human | Human cells | 760 | 2000 |
| CA70 | Ephrin-A1 | Human | Human cells | 840 | 2520 |
| CD74 | Ephrin-A1/EFNA1/TNFAIP4 | Mouse | Human cells | 200 | 560 |
| CD64 | Ephrin-A1/EFNA1/TNFAIP4 (Fc fusion) | Human | Human cells | 760 | 2000 |
| C464 | Ephrin-A3 | Human | Human cells | 240 | 640 |
| CK92 | Ephrin-A3/EFNA3 | Mouse | Human Cells | 760 | 2000 |
| C466 | Ephrin-A4/EFNA4 | Human | Human Cells | 440 | 1280 |
| CC50 | Ephrin-A4/EFNA4 | Mouse | Human cells | 240 | 720 |
| CD23 | Ephrin-A5/EFNA5 | Mouse | Human cells | 760 | 2000 |
| CJ76 | Ephrin-A5/EFNA5 | Human | Human cells | 840 | 2520 |
| CC54 | Ephrin-B1/EFNB1 | Human | Human cells | 760 | 2280 |
| C465 | Ephrin-B2 | Human | Human cells | 240 | 600 |
| CD70 | Ephrin-B2/EFNB2 | Mouse | Human cells | 200 | 560 |
| CK75 | Epidermal Growth Factor Receptor (V30G, Del31-297)/ErbB1/HER1 (C-6His) | Human | Human Cells | 840 | 2520 |
| CK80 | Epidermal Growth Factor Receptor (V30G, Del31-297)/ErbB1/HER1 (C-Fc) | Human | Human Cells | 840 | 2520 |
| CE11 | ER alpha/NR3A1 | Human | E.coli | 1200 | 3520 |
| CF53 | ER beta/NR3A2 | Human | E.coli | 840 | 2520 |
| CD93 | ERBB3/HER3 | Human | Human cells | 760 | 2000 |
| CA42 | ERO1-like protein alpha/ERO1L | Human | Human cells | 1200 | 3520 |
| CA66 | ERP27/Endoplasmic reticulum resident protein 27 | Human | Human cells | 840 | 2520 |
| C467 | Erythroid membrane-associated protein/ERMAP | Human | Human cells | 840 | 2520 |
| C341 | ESAM | Human | Human cells | 560 | 1680 |
| C283 | Ethanolaminephosphotransferase 1/EPT1/SELI | Human | E.coli | 1200 | 3520 |
| CF51 | ETS1/EWSR2 | Human | E.coli | 1200 | 3520 |
| CK88 | Exostosin-Like 2/EXTL2 | Mouse | Human Cells | 840 | 2520 |
| C433 | Extracellular Matrix Metalloproteinase Inducer/Emmprin | Human | Human cells | 640 | 2000 |
| C468 | F11 Receptor/F11R/JAM-A | Human | Human cells | 840 | 2520 |
| CI95 | F9/Coagulation factor Ix chain | Human | Human cells | 760 | 2000 |
| C133 | FABP1/L-FABP | Human | E.coli | 840 | 2520 |
| C134 | FABP2/I-FABP | Human | E.coli | 400 | 1200 |
| C135 | FABP3/H-FABP | Human | E.coli | 840 | 2520 |
| C136 | FABP4/A-FABP | Human | E.coli | 840 | 2520 |
| C137 | FABP5/E-FABP | Human | E.coli | 840 | 2520 |
| C221 | FABP6/I-BABP | Human | E.coli | 1200 | 3520 |
| CI26 | FAM172A | Human | Human Cells | 1200 | 3520 |
| CH41 | FAM19A4/TAFA4 | Human | E.coli | 760 | 2000 |
| C343 | FAM3C | Human | Human cells | 840 | 2520 |
| C344 | FAM3D | Human | Human cells | 840 | 2520 |
| CP50 | Fas/TNFRSF6/CD95 (C-Fc) | Mouse | Human Cells | 760 | 2000 |
| CP49 | Fas/TNFRSF6/CD95(C-6His) | Mouse | Human Cells | 760 | 2000 |
| C139 | FBPase 1/FBP1/Fructose-1,6-bisphosphatase 1 | Human | E.coli | 640 | 1760 |
| CS40 | Fc epsilon RII/CD23 | Human | Human cells | 760 | 2000 |
| CP47 | Fc Receptor-like Protein 1/FCRL1/FcRH1 | Mouse | Human Cells | 760 | 2000 |
| CM60 | Fc γ RI/FCGR1A/CD64 | Human | Human Cells | 600 | 1440 |
| CM55 | Fc γ RI/FCGR1A/CD64 | Mouse | Human Cells | 600 | 1440 |
| CS35 | Fc γ RIIa/FCGR2A/CD32a | Human | Human cells | 760 | 2000 |
| CS29 | Fc γ RIIIA/FCGR3/CD16 | Mouse | Human cells | 760 | 2000 |
| CS37 | Fc γ RIIIA/FCGR3/CD16 (C-6His) | Mouse | Human cells | 760 | 2000 |
| CS11 | Fc γ RIIIA/FCGR3A/CD16a | Human | Human Cells | 760 | 2000 |
| CI01 | FCGRT & B2M Heterodimer | Human | Human cells | 840 | 2520 |
| CK96 | FcRn & B2M Heterodimer | Mouse | Human Cells | 600 | 1440 |
| CH48 | Ferritin heavy chain/FTH1 | Human | E.coli | 400 | 840 |
| CH51 | Ferritin heavy chain/FTH1(N-polyHis) | Human | E.coli | 400 | 840 |
| CH49 | Ferritin light chain/FTL | Human | E.coli | 400 | 840 |
| C425 | Fetuin A/AHSG | Human | Human cells | 640 | 1760 |
| C345 | Fetuin B/FETUB | Human | Human cells | 640 | 1760 |
| C520 | FGF R5/FGFRL1 | Human | Human cells | 560 | 1680 |
| CF05 | FGF1 intracellular-binding protein/FIBP | Human | E.coli | 1200 | 3520 |
| CH53 | FGF1/FGFa(C-polyHis) | Human | E.coli | 840 | 2520 |
| C043 | FGF1/FGFa/FGF acidic | Mouse | E.coli | 400 | 1120 |
| C049 | FGF1/FGFa/FGF acidic | Human | E.coli | 400 | 1120 |
| C222 | FGF12 | Human | E.coli | 640 | 1760 |
| C996 | FGF17 | Human | Human cells | 840 | 2520 |
| CG42 | FGF17 | Human | E.coli | 840 | 2520 |
| CG74 | FGF19 | Human | E.coli | 840 | 2520 |
| C044 | FGF2/FGFb/FGF basic | Mouse | E.coli | 400 | 1120 |
| C046 | FGF2/FGFb/FGF basic(132-288) | Human | E.coli | 400 | 1120 |
| C751 | FGF2/FGFb/FGF basic(134-288) | Human | E.coli | 840 | 2520 |
| C779 | FGF2/FGFb/FGF basic(143-288) | Human | E.coli | 840 | 2520 |
| C223 | FGF21 | Human | E.coli | 640 | 1760 |
| CA19 | FGF23 | Human | Human cells | 1200 | 3520 |
| C806 | FGF6/HST-2 | Human | E.coli | 840 | 2520 |
| CH73 | FGF7/FGF-7/KGF | Human | E.coli | 1200 | 3520 |
| CK13 | FGF-8a | Human | E.coli | 720 | 2000 |
| CK14 | FGF-8e | Human | E.coli | 840 | 2520 |
| CK12 | FGF-8f | Human | E.coli | 840 | 2520 |
| C198 | FGF9 | Human | E.coli | 936 | 2800 |
| C132 | FGH/Esterase D/ESD | Human | E.coli | 840 | 2520 |
| CR11 | Fibroblast growth factor 10/FGF10 | Human | E.coli | 840 | 2520 |
| CR04 | Fibroblast Growth Factor 17/FGF-17 | Mouse | E.coli | 840 | 2520 |
| CM25 | Fibroblast Growth Factor 2//FGF2/FGFb | Rat | E.coli | 840 | 2520 |
| CS24 | Fibroblast Growth Factor 21/FGF-21 | Cynomolgus | Human Cells | 840 | 2520 |
| CR08 | Fibroblast Growth Factor 4/FGF-4 | Human | E.coli | 840 | 2520 |
| CM88 | Fibroblast Growth Factor 7/FGF-7/KGF | Human | Human cells | 1200 | 3520 |
| C798 | Fibroblast growth factor 8/FGF-8b/AIGF/HBGF-8 | Human | E.coli | 840 | 2520 |
| CR12 | Fibroblast Growth Factor 9/FGF-9 | Mouse | E.coli | 840 | 2520 |
| CH38 | Fibronectin/FN | Human | E.coli | 240 | 640 |
| CF28 | FIS1/Mitochondrial fission 1 protein/TTC11/CGI-135 | Human | E.coli | 360 | 2280 |
| CC56 | FKBP2/FKBP13/PPIase FKBP2 | Human | Human cells | 840 | 2520 |
| CH60 | FKBP3/FKBP25 | Human | E.coli | 400 | 840 |
| CG71 | FKBP4/Peptidyl-prolyl cis-trans isomerase FKBP4 |
Human | E.coli | 360 | 840 |
| CA33 | FKBP7/PPIase FKBP7 | Human | Human cells | 1200 | 3520 |
| C140 | Flap endonuclease 1/FEN-1 | Human | E.coli | 840 | 2520 |
| C348 | FLRT1 | Human | Human cells | 640 | 1760 |
| C349 | FLRT2 | Human | Human cells | 640 | 1760 |
| C970 | FLRT3 | Human | Human cells | 840 | 2520 |
| CC51 | FLT3 | Human | Human Cells | 840 | 2520 |
| CA82 | Flt3L/Fms-related tyrosine kinase 3 ligand | Human | Human cells | 840 | 2520 |
| CC19 | Flt3L/Fms-related tyrosine kinase 3 ligand | Mouse | Human cells | 936 | 2800 |
| CK93 | Fms-Like Tyrosine Kinase 3 Ligand/FLT3LG | Mouse | Human Cells | 840 | 2520 |
| C784 | Folate receptor alpha/FOLR1 | Human | Human cells | 760 | 2000 |
| CM28 | Follicle-Stimulating Hormone α/β Dimer | Human | Human Cells | 1200 | 3520 |
| CC94 | Follistatin-like 1/FSTL1 | Human | Human cells | 760 | 2000 |
| CM56 | Follistatin-Like 1/FSTL1 (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM57 | Follistatin-Like 1/FSTL1 (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| CA13 | Follitropin subunit beta/FSHB | Human | Human cells | 1200 | 3520 |
| CM12 | Frizzled 2/FZD2 | Mouse | Human Cells | 600 | 1440 |
| CM61 | Frizzled-1/Fz-1/Fzd1 | Mouse | Human Cells | 600 | 1440 |
| CD77 | Fructose-1,6-bisphosphatase 1/FBP1 | Human | Human cells | 640 | 1760 |
| C202 | Fructose-bisphosphate aldolase A/ALDOA | Human | E.coli | 840 | 2520 |
| CF24 | FSTL1/Follistatin-like 1 | Human | E.coli | 760 | 2000 |
| CF23 | FSTL1/Follistatin-like 1 (C-polyHis) | Human | E.coli | 840 | 2520 |
| C224 | Fumarase/FH | Human | E.coli | 1200 | 3520 |
| C874 | Fumarylacetoacetase/FAH | Human | Human cells | 1200 | 3520 |
| C826 | G6PD/Glucose-6-phosphate 1-dehydrogenase | Human | Human cells | 1200 | 3520 |
| CH32 | GABA(A) receptor-associated protein/GABARAP | Human | E.coli | 840 | 2520 |
| C143 | GABARAP/Apg8p1 | Human | E.coli | 80 | 240 |
| C269 | GABARAPL1 | Human | E.coli | 1200 | 3520 |
| CE65 | GADD45A/DNA damage-inducible transcript 1 protein/DDDIT-1 | Human | E.coli | 1200 | 3520 |
| CE37 | GADD45B/MYD118 | Human | E.coli | 1200 | 3520 |
| CE26 | GADD45G/CR6/DDIT2 | Human | E.coli | 1200 | 3520 |
| CE38 | Galactokinase/GALK1 | Human | E.coli | 1200 | 3520 |
| C285 | Galectin-1/LGALS1 | Human | E.coli | 1200 | 3520 |
| C803 | Galectin-14/LGALS14/Gal-14 | Human | Human cells | 1200 | 3520 |
| C068 | Galectin-3 | Human | E.coli | 400 | 1120 |
| C846 | Galectin-3/LGALS3 | Human | Human cells | 720 | 2000 |
| C069 | Galectin-7 | Human | E.coli | 720 | 2000 |
| C081 | Galectin-8 | Human | E.coli | 720 | 2000 |
| CE89 | Galectin-related protein/LGALSL/HSPC159/GRP | Human | E.coli | 760 | 2280 |
| CB28 | GALK2/GK2 | Human | Human cells | 1200 | 3520 |
| CI50 | GALNT3/Polypeptide GalNAc transferase 3 |
Human | Human cells | 1200 | 3520 |
| CD50 | GALNT7/N-acetylgalactosaminyltransferase 7/GalNAc-T7 | Human | Human cells | 1200 | 3520 |
| C903 | GALNTL1/GalNAc-T-like protein 1 | Human | Human cells | 840 | 2520 |
| CI86 | Ganglioside GM2 activator/GM2A | Human | Human cells | 1200 | 3520 |
| C166 | Gankyrin/PSMD10 | Human | E.coli | 840 | 2520 |
| C225 | GAS-7/KIAA0394 | Human | E.coli | 1200 | 3520 |
| C657 | Gastric triacylglycerol lipase/LIPF | Human | Human cells | 1200 | 3520 |
| C953 | GC/Gc-globulin | Human | Human cells | 840 | 2520 |
| CG34 | GCDH/Glutaryl-CoA dehydrogenase, mitochondrial | Human | E.coli | 840 | 2520 |
| C002 | G-CSF | Human | E.coli | 1200 | 3520 |
| C799 | GDF-11/BMP-11 | Human | Human cells | 1200 | 3520 |
| C783 | GDF-8/Myostatin | Mouse | Human cells | 1200 | 3520 |
| CJ43 | GDF-8/Myostatin/MSTN | Human | Human cells | 1200 | 3520 |
| C226 | GDNF | Human | E.coli | 1200 | 3520 |
| CD55 | GDNF family receptor alpha-1/GFRA1/RETL1/TRNR1 | Human | Human cells | 400 | 840 |
| CJ30 | GDNF family receptor alpha-2/GFRA2 | Human | Human cells | 400 | 840 |
| CD08 | GDNF/ATF/Glial cell line-derived neurotrophic factor | Human | Human cells | 840 | 2520 |
| CE01 | GDP-L-fucose synthase/TSTA3/SDR4E1 | Human | E.coli | 1200 | 3520 |
| C700 | GFER/HPO/FAD-linked sulfhydryl oxidase ALR | Human | E.coli | 760 | 2000 |
| C471 | GFRα-1/GDNF R α-1 | Human | Human cells | 320 | 960 |
| C472 | GFRα-2/GDNF R α-2 | Human | Human cells | 320 | 960 |
| C229 | GGPPSase/GGPS1 | Human | E.coli | 1200 | 3520 |
| CP23 | GITR/TNFRSF18/CD357 | Human | Human Cells | 240 | 720 |
| C473 | GLB1/β-Galactosidase-1 | Human | Human cells | 936 | 2800 |
| CH77 | Glia maturation factor beta/GMFB | Human | E.coli | 400 | 840 |
| C227 | Glial fibrillary acidic protein/GFAP | Human | E.coli | 1200 | 3520 |
| C611 | Glioma pathogenesis-related protein 1/GliPR1 | Human | Human cells | 1200 | 3520 |
| C664 | Glucagon/GCG | Human | Human cells | 1200 | 3520 |
| CE02 | Glutamine synthetase/GLUL/GLNS | Human | E.coli | 1200 | 3520 |
| CK07 | Glutathione S-transferase P/GSTP1/FAEES3/GST3 | Human | E.coli | 1200 | 3520 |
| CE41 | Glutathione S-Transferase ζ 1/GSTZ1 | Human | E.coli | 1200 | 3520 |
| CE58 | Glutathione synthetase/GSS | Human | E.coli | 1200 | 3520 |
| CE34 | Glycine N-methyltransferase/GNMT | Human | E.coli | 1200 | 3520 |
| C474 | Glycoprotein A33/GPA33 | Human | Human cells | 840 | 2520 |
| C693 | Glypican 1/Gpc1 | Mouse | Human cells | 760 | 2000 |
| C353 | Glypican 5 | Human | Human cells | 640 | 1760 |
| CP53 | Glypican-1/GPC1 | Human | Human cells | 760 | 2000 |
| C003 | GM-CSF | Human | E.coli | 936 | 2800 |
| C040 | GM-CSF | Human | P. pastoris | 840 | 2520 |
| CJ46 | GM-CSF | Mouse | Human cells | 1200 | 3520 |
| CC79 | GM-CSF/CSF2 | Human | Human cells | 760 | 2280 |
| CK02 | GM-CSF/Granulocyte-macrophage colony-stimulating factor | Mouse | E.coli | 1200 | 3520 |
| C867 | GMP reductase 1/GMPR | Human | Human cells | 840 | 2520 |
| C902 | GnRH II/GNRH2/Progonadoliberin-2 | Human | Human cells | 1200 | 3520 |
| C354 | GNS/Glucosamine (N-acetyl)-6-Sulfatase | Human | Human cells | 1200 | 3520 |
| C933 | GOLM1/Golgi membrane protein 1 | Human | Human cells | 840 | 2520 |
| C836 | GPD1/Glycerol-3-phosphate dehydrogenase | Human | Human cells | 1200 | 3520 |
| C195 | Grancalcin/GCA | Human | E.coli | 840 | 2520 |
| C144 | Grancalcin/GCA(GST fusion) | Human | E.coli | 840 | 2520 |
| CB53 | Granulocyte Colony-Stimulating Factor/G-CSF/CSF1(C-6His) | Mouse | Human Cells | 1200 | 3520 |
| C355 | Granzyme A | Human | Human cells | 1200 | 3520 |
| C765 | Granzyme B(G,H)/GZMB | Mouse | Human cells | 1200 | 3520 |
| CM86 | Granzyme D/GZMD | Mouse | Human cells | 1200 | 3520 |
| C755 | Growth differentiation factor 15/GDF15 | Mouse | Human cells | 1200 | 3520 |
| CE35 | Growth factor receptor-bound protein 2/GRB2/ASH | Human | E.coli | 1200 | 3520 |
| CM02 | Growth Hormone Receptor/GHR/GHBP | Mouse | Human Cells | 600 | 1440 |
| C048 | Growth Hormone/Gh | Mouse | E.coli | 840 | 2520 |
| C725 | Growth hormone/GH(Pituitary,22kD) | Human | E.coli | 760 | 2000 |
| CD19 | Growth hormone-releasing factor/GHRF/GHRH/Somatoliberin | Human | Human cells | 160 | 360 |
| C230 | GRP/LSM4 | Human | E.coli | 1200 | 3520 |
| CG67 | Guanidinoacetate N-methyltransferase/GAMT | Human | E.coli | 760 | 2280 |
| CI46 | HACL1/HPCL2/PHYH2 | Human | Human cells | 1200 | 3520 |
| C644 | HAI-2/SPINT2 | Human | Human cells | 840 | 2520 |
| CH71 | Haptoglobin | Human | E.coli | 1200 | 3520 |
| CD97 | Haptoglobin/HP/Zonulin |
Human | Human cells | 1200 | 3520 |
| C356 | HAVCR2/TIM-3 | Human | Human cells | 560 | 1680 |
| CK27 | HBA1 | Human | E.coli | 1200 | 3520 |
| C231 | HBAZ/HBZ2 | Human | E.coli | 1200 | 3520 |
| CK22 | HBQ1 | Human | E.coli | 1200 | 3520 |
| CJ33 | HCLS1/Hematopoietic lineage cell-specific protein | Human | Human cells | 1200 | 3520 |
| C941 | HDGFRP3/HDGF2/Hepatoma-derived growth factor 2 | Human | Human cells | 1200 | 3520 |
| C274 | HDHD2 | Human | E.coli | 1200 | 3520 |
| C550 | HE4/WFDC2 | Human | Human cells | 840 | 2520 |
| C800 | Heat Shock 47kDa/SERPINH1 | Human | Human cells | 1200 | 3520 |
| CH63 | Heat shock protein beta-2/HSPB2 | Human | E.coli | 400 | 840 |
| CH75 | Heat shock protein beta-8/HSPB8 | Human | E.coli | 1200 | 3520 |
| C256 | Heat-Responsive Protein 12/Hrsp12 | Human | E.coli | 640 | 1752 |
| CF57 | Hematopoietic Prostaglandin D Synthase/Hpgds | Human | E.coli | 1200 | 3520 |
| CS13 | Heparin Binding EGF like Growth Factor/proHB-EGF | Human | Human Cells | 1200 | 3520 |
| C522 | Hepatocyte cell adhesion molecule/HepaCAM | Human | Human cells | 1200 | 3520 |
| CP63 | Hepatocyte Growth Factor Receptor/HGF R/cMet | Human | Human cells | 760 | 2000 |
| CF40 | Hepatoma-derived growth factor/HDGF | Human | E.coli | 760 | 2280 |
| CH13 | Hepcidin/HAMP/HEPC/LEAP1 | Human | E.coli | 1200 | 3520 |
| CG89 | Hexokinase-3/HK3 | Human | E.coli | 760 | 2000 |
| CH08 | Histatin-3/HTN3 | Human | E.coli | 1200 | 3520 |
| C290 | Histone chaperone ASF1A | Human | E.coli | 1200 | 3520 |
| CM13 | HLADG/CD74 | Mouse | Human Cells | 600 | 1440 |
| C232 | HLP2/HPCAL1 | Human | E.coli | 1200 | 3520 |
| C945 | HMBS/Porphobilinogen deaminase | Human | Human cells | 1200 | 3520 |
| CE66 | HMGB1/High mobility group protein B1/HMG-1 | Human | E.coli | 840 | 2520 |
| CH67 | HMGB1/High mobility group protein B1/HMG-1(MARI) | Human | E.coli | 840 | 2520 |
| C357 | HMGB1/HMG-1 | Human | Human cells | 1024 | 3080 |
| C987 | HMGB2/High mobility group protein B2 | Human | Human cells | 1200 | 3520 |
| C910 | HMGB3/High mobility group protein B3 | Human | Human cells | 840 | 2520 |
| C146 | HO-1/HMOX1/HSP32 | Human | E.coli | 840 | 2520 |
| CH90 | Host cell factor 2/HCFC2 | Mouse | E.coli | 840 | 2520 |
| CK28 | HOXB4 | Human | E.coli | 1200 | 3520 |
| CE50 | HPD/PPD/4HPPD/HPPDase | Human | E.coli | 1200 | 3520 |
| C862 | HR6B/UBE2B/Ubiquitin-protein ligase B | Human | Human cells | 840 | 2520 |
| C284 | HSF2 | Human | E.coli | 1200 | 3520 |
| CF72 | HSP40/DNAJB1 | Human | E.coli | 760 | 2000 |
| C251 | HSPB11/PP25 | Human | E.coli | 1200 | 3520 |
| CG80 | HSPB7/Heat shock protein beta-7 | Human | E.coli | 840 | 2520 |
| C760 | HTRA2/Serine protease HTRA2 | Human | Human cells | 400 | 840 |
| CJ90 | HVEM/TNFRSF14 | Mouse | Human cells | 400 | 840 |
| CI68 | Hyaluronan-binding protein 2/HABP2 | Human | Human cells | 1200 | 3520 |
| CA81 | Hyaluronidase-1/HYAL1 | Human | Human cells | 840 | 2520 |
| C279 | Hydroxyacid oxidase 1/HAO1 | Human | E.coli | 1200 | 3520 |
| C294 | Hypoxanthine-guanine phosphoribosyltransferase/HPRT1 | Human | E.coli | 1200 | 3520 |
| CS17 | Hypoxia up-regulated protein 1/HYOU1 | Human | Human cells | 840 | 2520 |
| CS30 | IAP/OA3/CD47 (C-6His) | Mouse | Human Cells | 760 | 2000 |
| CM62 | IAP/OA3/CD47 (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| CS08 | ICOS Ligand/B7-H2/CD275 | Mouse | Human Cells | 760 | 2000 |
| CC75 | IFNA1/IFNA13/LeIF D | Human | Human cells | 1200 | 3520 |
| C025 | IFNa2a | Human | E.coli | 400 | 1120 |
| C005 | IFNa2b | Human | E.coli | 400 | 1120 |
| CC24 | IFNA4 | Human | Human cells | 760 | 2000 |
| C662 | IFNA6/LeIF K/Interferon alpha-6 | Human | Human cells | 1200 | 3520 |
| C476 | IFNAR2 | Human | Human cells | 640 | 1760 |
| CK42 | IFN‑gamma R1/CD119 | Mouse | Human cells | 200 | 560 |
| CK43 | IFN‑gamma R1/CD119(Fc fusion) | Mouse | Human cells | 200 | 560 |
| C014 | IFN-gamma/IFNγ | Human | E.coli | 240 | 800 |
| C746 | IFN-gamma/IFNγ | Mouse | E.coli | 400 | 840 |
| CI57 | IFN-gamma/IFNγ | Human | Human cells | 400 | 1200 |
| CA25 | IFN-lambda 3/IL-28B | Human | Human cells | 1200 | 3520 |
| CC87 | IFNW1/Interferon omega-1 | Human | Human cells | 760 | 2280 |
| CD82 | Ig gamma-1 chain C region/IGHG1 | Human | Human cells | 1200 | 3520 |
| CD85 | Ig gamma-1 chain C region/IGHG1 | Mouse | Human cells | 1200 | 3520 |
| CK73 | IGF Binding Protein 6/IGFBP-6 | Mouse | Human Cells | 840 | 2520 |
| C031 | IGF1 | Human | E.coli | 160 | 400 |
| C023 | IGF1(Long-R3-IGF1) | Human | E.coli | 160 | 400 |
| CF61 | IGF2 | Human | E.coli | 720 | 2000 |
| C347 | IGFBP-4 | Human | Human cells | 936 | 2800 |
| CA41 | IGFBP-5 | Human | Human cells | 1200 | 3520 |
| CM97 | IgG2A Fc/Igg-2a | Rat | Human cells | 240 | 720 |
| C435 | IGSF4B/SynCAM3 | Human | Human cells | 560 | 1680 |
| C027 | IL-10 | Human | E.coli | 1200 | 3520 |
| CD04 | IL-10 | Human | Human cells | 1200 | 3520 |
| C697 | IL-10/Interleukin-10 | Mouse | E.coli | 1200 | 3520 |
| CC08 | IL-10RB/Interleukin-10 receptor subunit beta | Human | Human cells | 400 | 1200 |
| CC42 | IL-10RB/Interleukin-10 receptor subunit beta(Fc fusion) | Human | Human cells | 400 | 1200 |
| C006 | IL-11 | Human | P. pastoris | 1200 | 3520 |
| C757 | IL-11/Interleukin-11 | Mouse | Human cells | 1200 | 5200 |
| CJ59 | IL-11/Interleukin-11(Fc fusion) | Mouse | Human cells | 840 | 2520 |
| CI58 | IL-12 (IL12A & IL12B Heterodimer) | Human | Human cells | 1200 | 3520 |
| CJ25 | IL-12B/P40 | Human | Human cells | 840 | 2520 |
| CK49 | IL-12RB1/IL12RB/CD212 | Human | Human cells | 480 | 1440 |
| CK90 | IL-12RB2/IL-12R β2 | Mouse | Human Cells | 760 | 2000 |
| CK48 | IL-12RB2/IL12R-beta 2 | Human | Human cells | 480 | 1440 |
| C088 | IL-13 | Mouse | E.coli | 1200 | 3520 |
| CC89 | IL-13 | Human | Human cells | 1200 | 3520 |
| CD56 | IL-13(Pro22-Phe131) | Mouse | Human cells | 1200 | 3520 |
| CD57 | IL-13(Ser26-Phe131) | Mouse | Human cells | 1200 | 3520 |
| CH18 | IL-13(Ser26-Phe131) | Mouse | E.coli | 1200 | 3520 |
| C016 | IL-15 | Human | E.coli | 1200 | 3520 |
| CK34 | IL-15 R alpha/IL-15Rα | Human | Human cells | 1200 | 3520 |
| CK94 | IL-15 Receptor α & IL-15 Fusion Protein/IL15RA&IL15 | Human | Human Cells | 840 | 2520 |
| CJ86 | IL-15RA/Interleukin-15 receptor subunit alpha | Mouse | Human cells | 400 | 840 |
| C045 | IL-16 | Human | E.coli | 1200 | 3520 |
| CK11 | IL-16 | Mouse | E.coli | 840 | 2520 |
| C021 | IL-17/IL-17A | Human | E.coli | 400 | 1200 |
| C774 | IL-17A | Human | Human cells | 760 | 2000 |
| CI60 | IL-17A & IL17F Heterodimer | Human | Human cells | 1200 | 3520 |
| CK30 | IL-17B | Human | Human cells | 240 | 640 |
| C030 | IL-17F | Human | E.coli | 936 | 2800 |
| CA22 | IL-17F | Human | Human cells | 840 | 2520 |
| CD72 | IL-18/IL-1F4 | Human | Human cells | 840 | 2520 |
| CH29 | IL-18/IL-1F4 | Human | E.coli | 840 | 2520 |
| CJ49 | IL-18/IL-1F4 | Mouse | Human cells | 400 | 840 |
| CK06 | IL-18/IL-1F4 | Mouse | E.coli | 840 | 2520 |
| CB99 | IL-18BP | Human | Human cells | 360 | 840 |
| CB73 | IL-18RAP | Human | Human cells | 360 | 840 |
| CG93 | IL-1b(N-Met) | Human | E.coli | 840 | 2520 |
| C041 | IL-1F1/IL-1a | Mouse | E.coli | 1200 | 3520 |
| C070 | IL-1F1/IL-1a | Human | E.coli | 1200 | 3520 |
| C074 | IL-1F10/IL-1HY2 | Human | E.coli | 1200 | 3520 |
| C042 | IL-1F2/IL-1b | Mouse | E.coli | 1200 | 3520 |
| C033 | IL-1F3/IL-1Ra | Human | E.coli | 320 | 800 |
| C071 | IL-1F5/IL-36Ra | Human | E.coli | 1200 | 3520 |
| C072 | IL-1F6/IL-36a | Human | E.coli | 1200 | 3520 |
| C477 | IL-1RAcP/IL1R3 | Human | Human cells | 320 | 960 |
| CA98 | IL-1RAP/IL1R3(Fc fusion) | Human | Human cells | 400 | 840 |
| CK20 | IL-1RN | Mouse | E.coli | 1200 | 3520 |
| CJ62 | IL-1Rrp2/IL-1R6/IL-36R | Human | Human cells | 720 | 2000 |
| C013 | IL-2 | Human | E.coli | 400 | 1200 |
| CD66 | IL-2 | Human | Human cells | 400 | 1200 |
| CK24 | IL-2 | Mouse | E.coli | 560 | 2120 |
| C147 | IL-20 | Human | E.coli | 1200 | 3520 |
| C614 | IL-20RA | Human | Human cells | 640 | 1760 |
| CB04 | IL-20RA (Fc fusion) | Human | Human cells | 760 | 2000 |
| CC41 | IL-20RB | Human | Human Cells | 840 | 2520 |
| CC45 | IL-21 | Human | E.coli | 1200 | 3520 |
| CK10 | IL-21/Interleukin-21 | Mouse | E.coli | 1200 | 3520 |
| CC81 | IL-21R/Interleukin-21 receptor | Human | Human cells | 360 | 840 |
| C047 | IL-22 | Mouse | E.coli | 1200 | 3520 |
| CH50 | IL-22 | Human | E.coli | 1200 | 3520 |
| C952 | IL-22BP/IL-22RA2 | Human | Human cells | 840 | 2520 |
| CJ29 | IL-22RA2/Interleukin-22 receptor subunit alpha-2 | Human | Human cells | 840 | 2520 |
| CP20 | IL-23 Recetor/IL-23R (C-6His) | Human | Human Cells | 760 | 2000 |
| CP09 | IL-23 Recetor/IL-23R (C-Fc) | Human | Human Cells | 760 | 2000 |
| CJ40 | IL-23(IL23A&IL12B) | Human | Human cells | 1200 | 3520 |
| CG64 | IL-25/C19orf10(N-polyHis) | Human | E.coli | 360 | 840 |
| C792 | IL-25/IL-17E | Human | Human cells | 840 | 2520 |
| CK32 | IL-2RA/CD25 | Mouse | Human cells | 760 | 2280 |
| CJ77 | IL-2RA/CD25/IL-2 receptor subunit alpha | Human | Human cells | 840 | 2520 |
| CJ81 | IL-2RB/CD122/Interleukin-2 receptor subunit beta | Human | Human cells | 1200 | 3520 |
| CJ53 | IL-2RG/CD132(Fc fusion) | Human | Human cells | 720 | 2000 |
| CF63 | IL-3 | Human | E.coli | 840 | 2520 |
| CD90 | IL-3 |
Human | Human cells | 840 | 2520 |
| C053 | IL-31 | Human | E.coli | 1200 | 3520 |
| C496 | IL-31RB/OSMRB | Human | Human cells | 640 | 1752 |
| C091 | IL-33 | Human | E.coli | 1200 | 3520 |
| CG73 | IL-33 | Mouse | E.coli | 840 | 2520 |
| C233 | IL-33 (C-polyHis) | Human | E.coli | 1200 | 3520 |
| C758 | IL-33/PRSS8 | Mouse | Human cells | 1200 | 3520 |
| C742 | IL-36a/Interleukin-36 alpha | Mouse | E.coli | 840 | 2520 |
| CK25 | IL-36b/IL1F8 | Mouse | E.coli | 640 | 1760 |
| C050 | IL-4 | Human | E.coli | 936 | 2800 |
| CD03 | IL-4 | Human | Human cells | 760 | 2280 |
| CK15 | IL-4 | Mouse | E.coli | 760 | 2280 |
| CD88 | IL-4(C-polyHis) | Human | Human cells | 840 | 2520 |
| CI59 | IL-5 | Human | Human cells | 1200 | 3520 |
| C009 | IL-6 | Human | E.coli | 936 | 2800 |
| CG39 | IL-6 | Mouse | E.coli | 1200 | 3520 |
| C691 | IL-6Ra/IL6R/HABP2/Interleukin-6 receptor subunit alpha |
Human | Human cells | 840 | 2520 |
| C086 | IL-7 | Human | E.coli | 1200 | 3520 |
| CD47 | IL-7 | Human | Human cells | 1200 | 3520 |
| CK77 | IL-7R α/IL-7RA/CD127 | Mouse | Human Cells | 760 | 2000 |
| CA17 | IL-9 | Human | Human cells | 1200 | 3520 |
| C234 | IMP1/IMPA1 | Human | E.coli | 1200 | 3520 |
| CE98 | IMP2/IGF2 mRNA-binding protein 2 |
Human | E.coli | 1200 | 3520 |
| CP58 | Importin Subunit Beta-1/KPNB1 | Human | E.coli | 1200 | 3520 |
| CP06 | Indoleamine 2,3-Dioxygenase/IDO/INDO | Human | E.coli | 1200 | 3520 |
| CP07 | Indoleamine 2,3-Dioxygenase/IDO/INDO | Mouse | E.coli | 1200 | 3520 |
| C475 | Inducible Co-Stimulator Ligand/Icoslg | Human | Human cells | 840 | 2520 |
| CS46 | Inducible T-cell Costimulator/ICOS | Mouse | Human cells | 240 | 720 |
| CC38 | Inducible T-cell costimulator/ICOS/AILIM/CD278 | Human | Human cells | 760 | 2000 |
| C905 | INHBC/NACGT1 | Human | Human cells | 1200 | 3520 |
| C687 | Inhibin beta A chain/Activin A/INHBA | Human | Human cells | 1200 | 3520 |
| C296 | Inhibin beta C chain/Activin beta-C chain/INHBC | Human | E.coli | 1200 | 3520 |
| CE23 | Inosine triphosphate pyrophosphatase/ITPA | Human | E.coli | 1200 | 3520 |
| CG79 | Inosine-5'-monophosphate dehydrogenase 2/IMPDH2 | Human | E.coli | 840 | 2520 |
| CE24 | Inositol monophosphatase 2/IMPA2 | Human | E.coli | 1200 | 3520 |
| C955 | INPP1/Inositol polyphosphate 1-phosphatase | Human | Human cells | 1200 | 3520 |
| CI49 | INPP5A/Type I inositol 1,4,5-trisphosphate 5-phosphatase |
Human | Human cells | 1200 | 3520 |
| CI47 | INSL3/Insulin-like 3 | Human | Human cells | 760 | 2000 |
| C988 | INSL4/Placentin | Human | Human cells | 1200 | 3520 |
| CA05 | Insulysin/IDE | Human | Human cells | 1200 | 3520 |
| C478 | Integrin alpha-5/CD49e | Human | Human cells | 840 | 2520 |
| CH39 | Intelectin-1/ITLN1 | Human | E.coli | 840 | 2520 |
| CK81 | Intercellular Adhesion Molecule 2/ICAM-2/CD102 | Mouse | Human Cells | 240 | 720 |
| C358 | Interferon alpha/beta receptor 1/IFN-α/β R1 | Human | Human cells | 640 | 1760 |
| CD10 | Interferon alpha/beta receptor 2/IFNAR2 | Human | Human cells | 760 | 2000 |
| CI70 | Interferon gamma receptor 1/IFNGR1 | Human | Human cells | 400 | 840 |
| CS36 | Interferon Lambda-2/IL-28A | Human | Human cells | 840 | 2520 |
| CF18 | Interferon regulatory factor 5/IRF5 | Human | E.coli | 1200 | 3520 |
| CK83 | Interferon α-2 | Mouse | E.coli | 240 | 720 |
| CM40 | Interferon γ/IFN-γ/IFNg | Mouse | Human Cells | 520 | 1200 |
| CM41 | Interferon γ/IFN-γ/IFNg (C-6His) | Mouse | Human Cells | 520 | 1200 |
| CM46 | Interferon ζ/IFN-ζ/Limitin | Mouse | Human Cells | 1200 | 3520 |
| CP28 | Interleukin-1 Receptor Type 1/IL-1R-1 (C-6His) | Human | Human Cells | 760 | 2000 |
| CP29 | Interleukin-1 Receptor Type 1/IL-1R-1 (C-Fc) | Human | Human Cells | 760 | 2000 |
| CP35 | Interleukin-1 Receptor Type 1/IL-1RI/IL-1R1 (C-Fc) | Mouse | Human Cells | 400 | 1200 |
| CP32 | Interleukin-1 Receptor Type 2/IL-1 RII (C-6His) | Mouse | Human Cells | 760 | 2000 |
| CP36 | Interleukin-1 Receptor Type 2/IL-1 RII/IL-1R2 (C-Fc) | Mouse | Human Cells | 760 | 2000 |
| CP30 | Interleukin-1 Receptor Type 2/IL-1R-2 (C-6His) | Human | Human Cells | 760 | 2000 |
| CP31 | Interleukin-1 Receptor Type 2/IL-1R-2 (C-Fc) | Human | Human Cells | 760 | 2000 |
| CI84 | Interleukin-1 receptor-like 1/IL1RL1 | Human | Human cells | 400 | 840 |
| CK89 | Interleukin-1 Receptor-Like 1/IL-1RL1/IL-1 R4 (C-6His) | Mouse | Human Cells | 760 | 2000 |
| CK95 | Interleukin-1 Receptor-Like 1/IL-1RL1/IL-1 R4 (C-Fc) | Mouse | Human Cells | 760 | 2000 |
| CM38 | Interleukin-12 Subunit β/IL-12 p40/IL-12B | Mouse | Human Cells | 840 | 2520 |
| CM39 | Interleukin-12/IL-12 | Mouse | Human Cells | 1200 | 3520 |
| CS32 | Interleukin-13 Receptor Subunit Alpha-1/IL-13RA1 | Human | Human cells | 400 | 840 |
| CS27 | Interleukin-17F/IL-17F | Human | Human Cells | 840 | 2520 |
| CM45 | Interleukin-18 Binding Protein Isoform d/IL-18 BPd | Mouse | Human Cells | 520 | 1200 |
| CC35 | Interleukin-18 Receptor Accessory Protein/Il18Rap(Fc-fusion) | Human | Human cells | 840 | 2520 |
| CR07 | Interleukin-21/IL-21 | Mouse | E.coli | 1200 | 3520 |
| CM72 | Interleukin-22/IL-22 | Mouse | Human Cells | 1200 | 3520 |
| CM69 | Interleukin-22/IL-22 (C-hIgG2 Fc) | Human | Human Cells | 1200 | 3520 |
| CM70 | Interleukin-22/IL-22 (C-hIgG4 Fc) | Human | Human Cells | 840 | 2520 |
| CM71 | Interleukin-22/IL-22 (C-mFc) | Mouse | Human Cells | 840 | 2520 |
| CK84 | Interleukin-23 Receptor/IL-23R | Mouse | Human Cells | 760 | 2000 |
| CS31 | Interleukin-23/IL-23 | Mouse | Human Cells | 1440 | 4320 |
| CB65 | Interleukin-27/IL-27 | Human | Human Cells | 1440 | 4320 |
| CS44 | Interleukin-27/IL-27 | Mouse | Human cells | 1440 | 4320 |
| CS26 | Interleukin-28B/IL-28B/IFN-lambda 3 | Human | Human Cells | 840 | 2520 |
| CP39 | Interleukin-3/IL-3 | Mouse | Human cells | 1200 | 3520 |
| CM89 | Interleukin-35/IL-35 | Human | Human cells | 760 | 2000 |
| CM77 | Interleukin-36γ/IL-36γ/IL-1F9 | Human | E.coli | 1200 | 3520 |
| C073 | Interleukin-37/Il-37 | Human | E.coli | 1200 | 3520 |
| CS33 | Interleukin-4 Receptor Subunit Alpha/IL-4 Rα | Human | Human cells | 840 | 2520 |
| CS38 | Interleukin-4 Receptor Subunit Alpha/IL-4 Rα(C-Fc) | Human | Human cells | 760 | 2000 |
| CK74 | Interleukin-4/IL-4 | Mouse | Human Cells | 840 | 2520 |
| CF42 | IR1B4/PRMT1 | Human | E.coli | 840 | 2520 |
| CM35 | Irisin/FNDC5 (C-6His) | Human/Mouse/Rat | Human Cells | 840 | 2520 |
| CM36 | Irisin/FNDC5 (C-Fc) | Human/Mouse/Rat | Human Cells | 840 | 2520 |
| CG40 | ISG15/UCRP | Human | E.coli | 360 | 840 |
| C943 | Isocitrate Dehydrogenase 1/IDH1 | Human | Human cells | 1200 | 3520 |
| CM21 | Isocitrate Dehydrogenase 1/IDH1 (C-8His) | Human | E.coli | 1200 | 3520 |
| CM34 | Isocitrate Dehydrogenase 1/IDH1 (R132H,C-8His) | Human | E.coli | 1200 | 3520 |
| CE49 | Isopentenyl pyrophosphate isomerase 2/IDI2 | Human | E.coli | 1200 | 3520 |
| CI25 | ITIH3/Inter-alpha-trypsin inhibitor heavy chain H3 Protein | Human | Human cells | 1200 | 3520 |
| C679 | ITM2B/imBRI2/BRI | Human | Human cells | 1200 | 3520 |
| CD94 | Izumo sperm-egg fusion protein 4/IZUMO4/C19orf36 | Human | Human cells | 760 | 2000 |
| CB95 | Jagged-1/JAG1 | Human | Human cells | 1200 | 3520 |
| C359 | JAM-B/VE-JAM | Human | Human cells | 560 | 1680 |
| CC52 | JAM-B/VE-JAM (Fc fusion) | Human | Human cells | 760 | 2000 |
| C481 | Kallikrein 1/KLK1 | Human | Human cells | 1200 | 3520 |
| C360 | Kallikrein 10/KLK10 | Human | Human cells | 1200 | 3520 |
| C361 | Kallikrein 11/KLK11 | Human | Human cells | 1200 | 3520 |
| C362 | Kallikrein 13/KLK13 | Human | Human cells | 1200 | 3520 |
| CI30 | Kallikrein 3/KLK3/PSA(25-261) | Human | Human cells | 1200 | 3520 |
| C365 | Kallikrein 3/PSA/KLK3(18-261) | Human | Human cells | 1200 | 3520 |
| C363 | Kallikrein 4/EMSP1/KLK4 | Human | Human cells | 1200 | 3520 |
| C415 | Kallikrein 5/KLK5 | Human | Human cells | 1200 | 3520 |
| C366 | Kallikrein 6/Neurosin/KLK6 | Human | Human cells | 1200 | 3520 |
| C364 | Kallikrein 7/KLK7 | Human | Human cells | 1200 | 3520 |
| CK86 | Kallikrein 7/KLK7 | Mouse | Human Cells | 1200 | 3520 |
| C367 | Kallikrein 8/KLK8/Neuropsin | Human | Human cells | 1200 | 3520 |
| C928 | Kallistatin/Serpin A4 | Human | Human cells | 1200 | 2520 |
| CM66 | Kanamycin kinase type II/NEO | Klebsiella pneumoniae | E.coli | 840 | 2520 |
| CJ26 | Kelch-like protein 41/KEL | Human | Human cells | 840 | 2520 |
| CC61 | Ketohexokinase/KHK | Human | Human cells | 760 | 2280 |
| CJ68 | Killer cell lectin-like receptor subfamily B member 1/KLRB1/CD161 | Human | Human cells | 1200 | 3520 |
| C523 | Kininogen | Human | Human cells | 1200 | 3520 |
| CP17 | KIR2DL3/NKAT2/CD158b2 (C-6His) | Human | Human Cells | 760 | 2000 |
| CP18 | KIR2DL3/NKAT2/CD158b2 (C-Fc) | Human | Human Cells | 760 | 2000 |
| CD53 | Kit ligand/KITLG/SCF | Human | Human cells | 760 | 2280 |
| CJ20 | KLKB1/Plasma kallikrein | Human | Human cells | 840 | 2520 |
| CE62 | KPNA2/RCH1/SRP1 | Human | E.coli | 1200 | 3520 |
| CH54 | Krueppel-like factor 6/KLF6 | Human | E.coli | 1200 | 3520 |
| C148 | Lacritin/LACRT | Human | E.coli | 840 | 2520 |
| C149 | LACTB2/β-lactamase-like protein 2 | Human | E.coli | 840 | 2520 |
| C900 | Lactotransferrin/LTF | Human | Human cells | 840 | 2520 |
| CK56 | LAG-3 | Mouse | Human Cells | 1200 | 3520 |
| CJ91 | LAG3/CD223/Lymphocyte activation gene 3 Protein | Human | Human cells | 720 | 2000 |
| C368 | LAIR1/CD305 | Human | Human cells | 560 | 1680 |
| C369 | LAIR2/CD306 | Human | Human cells | 640 | 1760 |
| CD49 | LALBA/LYZL7/Alpha-lactalbumin | Human | Human cells | 1200 | 3520 |
| C483 | LAMP2/CD107b | Human | Human cells | 640 | 1760 |
| C370 | LBP/Lipopolysaccharide-binding protein | Human | Human cells | 936 | 2800 |
| CA95 | LCAT/Lecithin-cholesterol acyltransferase | Human | Human cells | 1200 | 3520 |
| CJ12 | LDHA/Ldh1/L-lactate dehydrogenase | Mouse | Human cells | 1200 | 3520 |
| C235 | LDHA/PIG19 | Human | E.coli | 1200 | 3520 |
| C236 | LDH-B | Human | E.coli | 1200 | 3520 |
| CC70 | LDLR(avi) | Human | Human cells | 1200 | 3520 |
| CA88 | LDLR/Low-density lipoprotein receptor | Human | Human cells | 840 | 2440 |
| CS50 | Left-right Determination Factor 2 | Human | Human cells | 240 | 720 |
| C371 | Legumain/Asparaginyl Endopeptidase | Human | Human cells | 1200 | 3520 |
| CJ83 | Legumain/Asparaginyl Endopeptidase | Mouse | Human cells | 1200 | 3520 |
| C067 | Leptin | Human | E.coli | 200 | 400 |
| CM20 | Leptin | Carassius auratus | Yeast | 840 | 2520 |
| CD80 | Leucine-rich alpha-2-glycoprotein/LRG1 | Human | Human cells | 760 | 2280 |
| CB74 | Leucine-rich alpha-2-glycoprotein/LRG1(Fc fusion) | Human | Human cells | 840 | 2520 |
| C686 | Leucine-rich repeat-containing protein 3B/LRRC3B | Human | Human cells | 840 | 2520 |
| C484 | Leukocyte Immunoglobulin-Like Receptor Subfamily B Member 1/Lir-1 | Human | Human cells | 560 | 1680 |
| C485 | Leukocyte Immunoglobulin-Like Receptor Subfamily B Member 2/Lir-2 | Human | Human cells | 560 | 1680 |
| C017 | LIF/Leukemia inhibitory factor | Human | E.coli | 840 | 2520 |
| C690 | LIF/Leukemia inhibitory factor | Mouse | E.coli | 760 | 2000 |
| CM84 | LIGHT/HVEM-L/TNFSF14/CD258 | Human | Human cells | 840 | 2520 |
| CG84 | LIM and cysteine-rich domains protein 1/LMCD1/Dyxin | Human | E.coli | 1200 | 3520 |
| CD98 | Lipocalin-2/LCN2/p25/NGAL | Human | Human cells | 760 | 2000 |
| C845 | LMAN2/C5orf8/Glycoprotein GP36b | Human | Human cells | 840 | 2520 |
| CI79 | LMAN2L/VIP36-like protein | Human | Human cells | 840 | 2520 |
| C574 | LMIR1/CD300A | Human | Human cells | 760 | 2000 |
| CK31 | LMIR1/CD300A | Mouse | Human cells | 760 | 2280 |
| C443 | LMIR2/CD300C | Human | Human cells | 640 | 1760 |
| C201 | LMW-PTP/ACP1 | Human | E.coli | 840 | 2520 |
| CS21 | Low Affinity IgG Fc Region Receptor IV/FcgR4/CD16-2 | Mouse | Human Cells | 760 | 2000 |
| C767 | Low affinity immunoglobulin gamma Fc region receptor II/CD32B | Mouse | Human cells | 760 | 2000 |
| C524 | LOX-1/OLR1 | Human | Human cells | 640 | 1760 |
| C032 | LR3-IGF-1 | Human | E.coli | 160 | 400 |
| CJ66 | LRRC19/Leucine-rich repeat-containing protein 19 | Human | Human cells | 1200 | 3520 |
| CI35 | LRRC25/Leucine-rich repeat-containing protein 25 | Human | Human cells | 1200 | 3520 |
| C618 | LRRTM2 | Human | Human cells | 840 | 2520 |
| CC84 | LSAMP/LAMP | Human | Human cells | 760 | 2000 |
| CI12 | L-selectin/SELL | Mouse | Human cells | 400 | 1200 |
| CI24 | LTA4H/Leukotriene A4 Hydrolase | Human | Human cells | 1200 | 3520 |
| CD78 | LTBR/TNFRSF3 | Mouse | Human cells | 760 | 2000 |
| C372 | Lumican | Human | Human cells | 640 | 1760 |
| C277 | L-xylulose reductase/DCXR | Human | E.coli | 1200 | 3520 |
| C487 | Ly6/PLAUR domain-containing protein 3/C4.4A/LYPD3/MIG-C4 | Human | Human cells | 640 | 1760 |
| CJ56 | LY86/MD-16/Lymphocyte antigen 86 | Human | Human cells | 720 | 2000 |
| CA64 | Lymphocyte antigen 6H/LY6H | Human | Human cells | 1200 | 3520 |
| CH70 | Lymphocyte cytosolic protein 2/LCP2 | Human | E.coli | 1200 | 3520 |
| C328 | Lymphotoxin beta R/TNFRSF3 | Human | Human cells | 320 | 960 |
| CF43 | LYPLA2/Acyl-protein thioesterase 2 | Human | E.coli | 760 | 2280 |
| C857 | Lysine--tRNA ligase/KARS | Human | Human cells | 1200 | 3520 |
| CI91 | Lysozyme C/LYZ | Human | Human cells | 840 | 2520 |
| CA07 | Lysozyme g-like protein 2/LYG2 | Human | Human cells | 1200 | 3520 |
| CS53 | Lysyl Oxidase Homolog 2/LOXL2(C-Avi-His) | Human | Human cells | 240 | 720 |
| C619 | LYVE-1 | Human | Human cells | 936 | 2800 |
| CP66 | Macrophage Colony-stimulating Factor 1 Receptor/M-CSF R/CSF1R/CD115 | Human | Human cells | 400 | 840 |
| CS42 | Macrophage Colony-stimulating Factor 1 Receptor/M-CSF R/CSF1R/CD115(C-Fc) | Human | Human cells | 400 | 10000 |
| C756 | Macrophage colony-stimulating factor 1/M-CSF/CSF1 | Mouse | Human cells | 1200 | 3520 |
| C692 | Macrophage metalloelastase/MMP12 | Mouse | Human cells | 1200 | 3520 |
| C897 | MAG/Siglec-4a | Human | Human cells | 840 | 2520 |
| C918 | MAN1B1/Mannosidase alpha class 1B member 1 | Human | Human cells | 840 | 2520 |
| CI17 | MANF/ARMET | Human | Human cells | 760 | 2000 |
| C655 | Mannan-binding lectin serine protease 1/MASP1 | Human | Human cells | 1200 | 3520 |
| CM90 | Mannose Binding Lectin 2/MBL-2/MBP-C | Mouse | Human cells | 760 | 2000 |
| C981 | MANSC1/LOH12CR3 | Human | Human cells | 1200 | 3520 |
| CE88 | MAP1LC3A/Apg8p3 | Human | E.coli | 760 | 2280 |
| C196 | Max | Human | E.coli | 840 | 2520 |
| CE69 | MBIP/MAP3K12-binding inhibitory protein 1 | Human | E.coli | 1200 | 3520 |
| C488 | MBL-2/MBP-C | Human | Human cells | 640 | 1760 |
| C417 | M-CSF | Human | Human cells | 1200 | 3520 |
| C470 | M-CSF/CSF1 | Rat | Human cells | 1200 | 3520 |
| C276 | MDH1/Malate dehydrogenase, cytoplasmic | Human | E.coli | 1200 | 3520 |
| CI48 | MDH2/Malate dehydrogenase, mitochondrial |
Human | Human cells | 1200 | 3520 |
| CI19 | MDP1/Magnesium-dependent phosphatase 1 |
Human | Human cells | 240 | 800 |
| C917 | MECR/Trans-2-enoyl-CoA reductase | Human | Human cells | 1200 | 3520 |
| C927 | Membrane Primary Amine Oxidase/AOC3 | Human | Human cells | 1440 | 4320 |
| CI94 | MERTK/MER/Receptor tyrosine kinase MerTK | Human | Human cells | 1200 | 3520 |
| CP51 | Mesothelin | Human | Human Cells | 600 | 1200 |
| CP52 | Mesothelin (C-Fc) | Human | Human Cells | 760 | 2000 |
| CM52 | Mesothelin/MPF/MSLN/CAK1 (C-6His) | Human | Human Cells | 600 | 1440 |
| CM51 | Mesothelin/MPF/MSLN/CAK1 (C-Fc) | Human | Human Cells | 600 | 1440 |
| CR21 | Methionine Aminopeptidase 1 | Human | E.coli | 760 | 2000 |
| CF03 | Methionine Aminopeptidase 1D/MAP1D/METAP1D | Human | E.coli | 840 | 2520 |
| CG86 | Methylated-DNA--protein-cysteine methyltransferase /MGMT |
Human | E.coli | 760 | 2280 |
| CI08 | Methyl-CpG-binding protein 2/MECP2 | Human | Human cells | 1200 | 3520 |
| CI82 | Methylmalonyl-CoA epimerase/MCEE | Human | Human cells | 400 | 1200 |
| CI81 | MFAP4/Microfibril-associated glycoprotein 4 | Human | Human cells | 400 | 1200 |
| C824 | MGAT2/Mannoside acetylglucosaminyltransferase 2 | Human | Human cells | 1200 | 3520 |
| C150 | MIA | Human | E.coli | 840 | 2520 |
| C489 | MICA/MHC-I related sequence A | Human | Human cells | 560 | 1760 |
| CG11 | MICA/MHC-I related sequence A(Fc fusion) | Human | Human cells | 760 | 2000 |
| CH27 | MIF/Macrophage migration inhibitory factor | Mouse | E.coli | 840 | 2520 |
| CH33 | MIF/Macrophage migration inhibitory factor | Human | E.coli | 1200 | 3520 |
| C525 | MINPP1/MIPP | Human | Human cells | 840 | 2520 |
| C237 | Miz-1/ZBTB17 | Human | E.coli | 1200 | 3520 |
| C374 | MMP-1/Interstitial collagenase | Human | Human cells | 1200 | 3520 |
| C377 | MMP-2/72 kDa type IV collagenase | Human | Human cells | 1200 | 3520 |
| C378 | MMP-3/Matrix metalloproteinase-3 | Human | Human cells | 1200 | 3520 |
| CI71 | MMP-9/metalloproteinase-9/CLG4B | Human | Human cells | 1200 | 3520 |
| C297 | MOB kinase activator 1A/MOB1A/MOBKL1B | Human | E.coli | 1200 | 3520 |
| C286 | MOB-like protein phocein/MOB4/MOBKL3 | Human | E.coli | 1200 | 3520 |
| C051 | MOG | Human | E.coli | 560 | 1680 |
| C565 | MOG | Human | Human cells | 840 | 2520 |
| CE43 | Mortality factor 4-like protein 2/MORF4L2/MRGX | Human | E.coli | 1200 | 3520 |
| CE21 | Mp1/MAPKSP1 | Human | E.coli | 1200 | 3520 |
| CH68 | Mrp8/Protein S100-A8 | Mouse | E.coli | 840 | 2520 |
| CH64 | MTHFS/5-formyltetrahydrofolate cyclo-ligase | Human | E.coli | 1200 | 3520 |
| CA16 | Mucin-15/MUC15 | Human | Human cells | 1200 | 3520 |
| C238 | Myelin P2 protein/PMP2 | Human | E.coli | 1200 | 3520 |
| C802 | Myelin peripheral protein/MPZ | Human | Human cells | 1200 | 3520 |
| CI85 | Myelin protein zero-like 1/MPZL1 | Human | Human cells | 400 | 840 |
| CG08 | Myozenin-2/MYOZ2 | Human | E.coli | 1200 | 3520 |
| C270 | NAD kinase/NADK | Human | E.coli | 1200 | 3520 |
| CF98 | NANS/N-acetylneuraminate synthase | Human | E.coli | 760 | 2280 |
| C275 | NAPA/Alpha-soluble NSF attachment protein | Human | E.coli | 1200 | 3520 |
| C154 | Natriuretic Peptides B/Nppb | Human | E.coli | 840 | 2520 |
| C763 | Natural Cytotoxicity Triggering Receptor 1/NKp46/NCR1 | Human | Human cells | 840 | 2520 |
| CC40 | Natural Cytotoxicity Triggering Receptor 3/NCR3 | Human | Human cells | 840 | 2520 |
| CS28 | Natural killer cell receptor 2B4/SLAMF4/CD244(C-6His) | Mouse | Human cells | 760 | 2000 |
| CK17 | NCF1 | Human | E.coli | 1200 | 3520 |
| CF49 | NCK1 | Human | E.coli | 760 | 2000 |
| C379 | NCR3/NKp30/NCR3/CD337 | Human | Human cells | 936 | 2800 |
| C299 | NDRG1/N-myc downstream-regulated gene 1 protein/NDRG1 | Human | E.coli | 1200 | 3520 |
| CG68 | NECAP2/Adaptin ear-binding coat-associated protein 2 | Human | E.coli | 760 | 2280 |
| C492 | Nectin-1/PVRL1 | Human | Human cells | 640 | 1760 |
| C172 | NEDP1/SENP8 | Human | E.coli | 240 | 560 |
| C997 | NELL1/NRP1 | Human | Human cells | 1200 | 3520 |
| CM47 | Nephroblastoma Overexpressed Gene /NOV/CCN3/IGFBP-9 | Mouse | Human Cells | 600 | 1440 |
| C916 | Netrin-G1/NTNG1 | Human | Human cells | 840 | 2520 |
| C999 | NEU-1/Sialidase-1 | Human | Human cells | 1200 | 3520 |
| CP45 | Neural Cell Adhesion Molecule 1/NCAM-1/CD56 | Human | Human Cells | 760 | 2000 |
| C495 | Neurexophilin-1 | Human | Human cells | 720 | 2000 |
| CH42 | Neuritin/NRN1 | Human | E.coli | 760 | 2000 |
| CK66 | Neuroblastoma Suppressor of Tumorigenicity 1/NBL1 | Mouse | Human Cells | 760 | 2000 |
| C239 | Neurocalcin-δ/NCALD | Human | E.coli | 1200 | 3520 |
| C493 | Neuroligin 1/NLGN1(46-693) | Human | Human cells | 640 | 1760 |
| CA77 | Neuroligin 4/NLGN4 | Human | Human cells | 840 | 2520 |
| C932 | Neuropeptide Y/NPY | Human | Human cells | 840 | 2520 |
| C494 | Neuroplastin | Human | Human cells | 840 | 2520 |
| CB27 | Neurotrimin | Human | Human cells | 1200 | 3520 |
| CH31 | Neutrophil gelatinase-associated lipocalin/LCN2 |
Human | E.coli | 760 | 2000 |
| CH12 | NFYA/Nuclear TF Y subunit alpha | Human | E.coli | 1200 | 3520 |
| CE78 | NFYA/Nuclear TF Y subunit alpha(GST fusion) | Human | E.coli | 1200 | 3520 |
| CM17 | NGAL/Lipocalin-2/LCN2 (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM18 | NGAL/Lipocalin-2/LCN2 (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| C787 | NGF R/TNFRSF16 | Mouse | Human cells | 760 | 2000 |
| C078 | NGF(with pro peptide) | Human | E.coli | 840 | 2520 |
| C060 | NGF(β-NGF) | Human | E.coli | 400 | 1200 |
| C531 | NgR3/NgRH2 | Human | Human cells | 840 | 2520 |
| C240 | NHP2-like protein 1/NHP2L1 | Human | E.coli | 1200 | 3520 |
| CE48 | NIP7/KD93 | Human | E.coli | 1200 | 3520 |
| CB20 | NKG2-A/NKG2-B Type II Integral Membrane Protein | Human | Human cells | 240 | 720 |
| CK78 | NKG2D Ligand 1/NKG2DL/ULBP1 | Human | Human Cells | 760 | 2000 |
| CD42 | NKG2D ligand 2/N2DL2/ULBP-2(Fc fusion) | Human | Human cells | 760 | 2000 |
| C508 | NKG2D ligand 2/ULBP-2/N2DL2 | Human | Human cells | 560 | 1680 |
| CP46 | NKG2-D type II Integral Membrane Protein/NKG2D/CD314 | Human | Human Cells | 760 | 2000 |
| C632 | Nogo Receptor/NgR | Human | Human cells | 560 | 1680 |
| CM42 | Nogo-66 Receptor/Reticulon 4 Receptor/NgR/RTN4R (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM16 | Nogo-66 Receptor/Reticulon 4 Receptor/NgR/RTN4R (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| CI34 | NPDC1/Neural proliferation differentiation and control protein
1 |
Human | Human cells | 760 | 2000 |
| CC04 | NRCAM/Neuronal cell adhesion molecule | Human | Human cells | 760 | 2000 |
| C753 | NRG1/Pro-neuregulin-1/NRG1‑beta 1 | Human | E.coli | 760 | 2000 |
| CI43 | NRN1L/Cpg15-2/Neuritin 1-like Protein | Human | Human cells | 760 | 2000 |
| C080 | NT-3(with pro peptide) | Human | E.coli | 840 | 2520 |
| C079 | NT-3/Neurotrophin-3 | Human | E.coli | 1200 | 3520 |
| CA38 | NTAL/LAT2 | Human | Human cells | 1200 | 3520 |
| C387 | NTB-A/SLAMF6 | Human | Human cells | 560 | 1680 |
| CG85 | Nucleolar protein family A member 2 /NHP2/NOLA2 |
Human | E.coli | 760 | 2280 |
| C241 | Nucleoside diphosphate kinase A/NM23-H1/NDPKA | Human | E.coli | 1200 | 3520 |
| CH76 | OASL/2'-5'-oligoadenylate synthase-like protein | Human | E.coli | 1200 | 3520 |
| C128 | OGG1/N-glycosylase/DNA lyase | Human | E.coli | 840 | 2520 |
| CS01 | Olfactomedin-4/OLFM4 | Human | Human Cells | 1200 | 3520 |
| C388 | ON/SPARC/BM-40 | Human | Human cells | 400 | 1120 |
| C099 | Oncostatin M/OSM | Human | E.coli | 1200 | 3520 |
| CG81 | Ornithine decarboxylase/ODC1 | Human | E.coli | 840 | 2520 |
| C497 | Osteoactivin/GPNMB | Human | Human cells | 640 | 1760 |
| CR03 | Osteocrin | Human | E.coli | 1200 | 3520 |
| C544 | Osteopontin/OPN/SPP-1 | Human | Human cells | 400 | 1280 |
| C325 | Osteoprotegerin/TNFRSF11B/OPG | Human | Human cells | 320 | 960 |
| C156 | OTX2 | Human | E.coli | 840 | 2520 |
| CJ45 | OX40 Ligand/TNFSF4/CD252 | Human | Human cells | 1200 | 3520 |
| CM74 | OX40 Ligand/TNFSF4/OX40L | Mouse | Human Cells | 840 | 2520 |
| CK60 | OX40/TNFRSF4 | Human | Human Cells | 760 | 2280 |
| CE72 | p21/CIP1/CDKN1A | Human | E.coli | 1200 | 3520 |
| C288 | p27/Kip1/Cyclin-dependent kinase inhibitor 1B/CDKN1B | Human | E.coli | 1200 | 3520 |
| CF68 | p50/POLD2/DNA polymerase delta subunit 2 | Human | E.coli | 1200 | 3520 |
| C834 | PACSIN1/Syndapin-1 | Human | Human cells | 1200 | 3520 |
| C929 | PACSIN2 | Human | Human cells | 1200 | 3520 |
| CF07 | PADI4/PADI5/PDI5 | Human | E.coli | 1200 | 3520 |
| CA52 | Pancreatic lipase-related protein 2/PNLIPRP2 | Human | Human cells | 840 | 2520 |
| CI10 | Pancreatic prohormone/PPY/PNP | Human | Human cells | 1200 | 3520 |
| CI62 | PAPSS1 | Human | Human cells | 1200 | 3520 |
| C766 | Parathyroid hormone 1 receptor/PTH1R | Human | Human cells | 760 | 2000 |
| CE29 | Partner of Y14 and mago/WIBG/PYM | Human | E.coli | 1200 | 3520 |
| C157 | Parvalbumin alpha/PVALB | Human | E.coli | 840 | 2520 |
| C245 | Parvalbumin β/OM/OCM | Human | E.coli | 1200 | 3520 |
| CG44 | Parvulin-14/PIN4 | Human | E.coli | 760 | 2280 |
| CE03 | PBLD/MAWBP | Human | E.coli | 1200 | 3520 |
| C844 | PCDH1/Protocadherin-1 | Human | Human cells | 1200 | 3520 |
| CD63 | PCDH10/protocadherin-10 | Human | Human cells | 640 | 1760 |
| CA83 | PCSK9/Proprotein Convertase 9 | Human | Human cells | 840 | 2000 |
| CA86 | PCSK9/Proprotein Convertase 9 | Mouse | Human cells | 1200 | 3520 |
| CA84 | PCSK9/Proprotein Convertase 9 (biotinylated) | Human | Human cells | 1200 | 3520 |
| CA85 | PCSK9/Proprotein Convertase 9 (biotinylated-his) | Human | Human cells | 1200 | 3520 |
| CJ98 | PD-1/PDCD1 | Mouse | Human cells | 400 | 1120 |
| CJ97 | PD-1/PDCD1(Fc fusion) | Mouse | Human cells | 400 | 1120 |
| CM98 | PDCD1/PD-1/CD279 | Cynomolgus monkey | Human Cells | 760 | 2000 |
| CM82 | PDCD1/PD-1/CD279 (C93S Mutant, C-6His) | Human | Human Cells | 840 | 2520 |
| CM81 | PDCD1/PD-1/CD279 (C-Fc) | Human | Human cells | 600 | 1440 |
| CD91 | PDCD1/Programmed cell death protein 1 | Human | Human cells | 760 | 2000 |
| CF25 | PDCD10/Programmed cell death protein 10 | Human | E.coli | 1200 | 3520 |
| CF62 | PDCD4/Programmed cell death protein 4 | Human | E.coli | 840 | 2520 |
| CG07 | PDCD5/Programmed cell death protein 5 | Human | E.coli | 760 | 2280 |
| C272 | PDCD8/AIF/AIFM1 | Human | E.coli | 1200 | 3520 |
| C298 | Pdgf-Associated Protein/Pap | Human | E.coli | 1200 | 3520 |
| C199 | PDGF-BB | Human | E.coli | 1200 | 3520 |
| CM96 | PDGFR α/PDGFRA/CD140a | Mouse | Human cells | 760 | 2000 |
| CP12 | PDGFR α/PDGFRA/CD140a (C-6His) | Mouse | Human Cells | 760 | 2000 |
| C380 | PDGFRβ/CD140b | Human | Human cells | 400 | 1200 |
| CC92 | PDIA3/Protein disulfide-isomerase A3 | Human | Human cells | 1200 | 3520 |
| CD96 | PDIA5/Protein disulfide-isomerase A5 | Human | Human cells | 1200 | 3520 |
| C527 | PDI-like protein of the testis/PDILT | Human | Human cells | 840 | 2520 |
| CJ88 | PD-L1/B7-H1/CD274 | Mouse | Human cells | 400 | 840 |
| CM33 | PD-L1/B7-H1/CD274 (C-Flag) | Human | Human Cells | 520 | 1200 |
| CM06 | PD-L1/B7-H1/CD274 (C-mFc) | Human | Human Cells | 520 | 1200 |
| CM79 | PD-L1/B7-H1/CD274(C-Fc) | Human | Human cells | 520 | 1200 |
| CJ89 | PD-L1/B7-H1/CD274(Fc fusion) | Mouse | Human cells | 400 | 840 |
| CF65 | PEA15/PED/Astrocytic phosphoprotein PEA-15 | Human | E.coli | 840 | 2520 |
| C510 | Pentraxin 2/SAP | Human | Human cells | 640 | 1760 |
| CK40 | Pentraxin 2/SAP | Mouse | Human cells | 1200 | 3520 |
| CG88 | Peptidase D/PEPD/PRD | Human | E.coli | 1200 | 3520 |
| CR15 | Peptidyl-prolyl Cis-trans Isomerase A/Cyclophilin A/CYPA | Human | E.coli | 240 | 720 |
| CR16 | Peptidyl-prolyl Cis-trans Isomerase A/Cyclophilin A/CYPA | Mouse | E.coli | 240 | 720 |
| CE96 | Peptidyl-Prolyl Cis-Trans Isomerase D/Ppid | Human | E.coli | 760 | 2280 |
| C253 | Peptidyl-Prolyl Cis-Trans Isomerase H/Ppih | Human | E.coli | 1200 | 3520 |
| C291 | Peptidyl-prolyl cis-trans isomerase-like 1/PPIL1 | Human | E.coli | 1200 | 3520 |
| CJ39 | Periostin(POSTN) | Human | Human cells | 760 | 2000 |
| CE06 | peroxiredoxin 6/PRDX6/AOP2 | Human | E.coli | 1200 | 3520 |
| CH58 | Peroxiredoxin-1/PRDX1 | Human | E.coli | 400 | 840 |
| CH87 | Peroxiredoxin-4 | Human | E.coli | 840 | 2520 |
| CE73 | Peroxiredoxin-4/PRDX4 | Human | E.coli | 1200 | 3520 |
| CK91 | Peroxiredoxin-5/PRDX5 | Human | Human Cells | 760 | 2000 |
| CR05 | Peroxisomal Acyl-coenzyme A Oxidase 1/ACOX1 | Human | E.coli | 1200 | 3520 |
| CE13 | PFDN4/PFD4 | Human | E.coli | 1200 | 3520 |
| CI45 | PFKFB1/PFK/FBPase 1 | Human | Human cells | 1200 | 3520 |
| CI40 | PFKM/Phosphofructokinase-M |
Human | Human cells | 840 | 2520 |
| CJ09 | PGCP/Carboxypeptidase Q/Hematopoietic lineage switch 2 | Mouse | Human cells | 1200 | 3520 |
| CA51 | PGD2 Synthase/PTGDS | Human | Human cells | 840 | 2520 |
| C848 | PGDH(15-PGDH)/HPGD | Human | Human cells | 1200 | 3520 |
| CI37 | PGF/Placenta growth factor |
Mouse | Human cells | 1200 | 3520 |
| CI52 | PGK1/PGKA | Human | Human cells | 1200 | 3520 |
| CF45 | PHLDA2/BWR1C/HLDA2/IPL/TSSC3 | Human | E.coli | 840 | 2520 |
| CM65 | Phosphinothricin N-acetyltransferase/Bar | Streptomyces hygroscopicus | E.coli | 840 | 2520 |
| CM27 | Phosphoglucomutase 2/PGM2 | Human | E.coli | 840 | 2520 |
| CD51 | Phosphoinositide-3-kinase-interacting protein 1/PIK3IP1/HGFL | Human | Human cells | 760 | 2000 |
| C246 | PHS/PCBD1 | Human | E.coli | 1200 | 3520 |
| C921 | PI4KB/Phosphatidylinositol 4-kinase beta | Human | Human cells | 1200 | 3520 |
| C381 | PIGR/Polymeric immunoglobulin receptor | Human | Human cells | 640 | 1760 |
| C218 | PIN/DYNLL1 | Human | E.coli | 1200 | 3520 |
| C287 | PIN2/PINX1 | Human | E.coli | 1200 | 3520 |
| CJ35 | PIP4K2A/Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha | Human | Human cells | 1200 | 3520 |
| CE10 | PITPNA/PITPN | Human | E.coli | 1200 | 3520 |
| C247 | PKI-β/PKIB | Human | E.coli | 1200 | 3520 |
| CE82 | PLA2G16/HRSL3 | Human | E.coli | 840 | 2520 |
| CJ15 | PLA2G1B/Phospholipase A2/PLA2/PLA2A/PPLA2 | Human | Human cells | 1200 | 3520 |
| C457 | Placental Lactogen/CSH1 | Human | Human cells | 936 | 2800 |
| CD21 | Plasminogen activator inhibitor 1 /PAI/SERPIN E1 |
Mouse | Human cells | 1200 | 3520 |
| CS06 | Platelet Receptor Gi24/VISTA/B7-H5 | Mouse | Human Cells | 760 | 2000 |
| C244 | Platelet-activating factor acetylhydrolase IB subunit
beta/PAFAHB |
Human | E.coli | 1200 | 3520 |
| C624 | Platelet-Activating Factor Acetylhydrolase/Pafah | Human | Human cells | 1200 | 3520 |
| CH79 | Platelet-derived growth factor subunit A/PDGFA | Human | E.coli | 1200 | 3520 |
| CH46 | Platelet-derived growth factor subunit A/PDGFA(N-polyHis) | Human | E.coli | 1200 | 3520 |
| C790 | plexin domain-containing protein 2/PLXDC2 | Mouse | Human cells | 1200 | 3520 |
| C681 | PLRP1/Pancreatic lipase-related protein 1 | Human | Human cells | 840 | 2520 |
| C768 | PM20D1/Probable carboxypeptidase PM20D1 | Mouse | Human cells | 1200 | 3520 |
| C248 | PMKase/PMVK | Human | E.coli | 1200 | 3520 |
| C249 | PMM1/Phosphomannomutase 1 | Human | E.coli | 1200 | 3520 |
| C250 | PMM2/Phosphomannomutase 2 | Human | E.coli | 1200 | 3520 |
| C528 | Podoplanin/PDPN/Aggrus | Human | Human cells | 560 | 1680 |
| CA99 | Podoplanin/PDPN/GP36(Fc fusion) | Human | Human cells | 760 | 2000 |
| CS09 | Poliovirus Receptor/PVR/CD155 | Mouse | Human Cells | 760 | 2000 |
| CI09 | Polymeric immunoglobulin receptor/PIGR | Human | Human cells | 760 | 2000 |
| CH55 | Polyubiquitin-B/UBB | Human | E.coli | 840 | 2520 |
| C671 | POMGNT1 | Human | Human cells | 1200 | 3520 |
| C161 | PP2C alpha/PPM1A | Human | E.coli | 640 | 1760 |
| C252 | PPC-DC/COAC | Human | E.coli | 1200 | 3520 |
| CE80 | PPP1CC/Protein phosphatase 1C catalytic subunit | Human | E.coli | 1200 | 3520 |
| C163 | PPP1R1A/Protein phosphatase 1 regulatory subunit 1A/IPP-1 | Human | E.coli | 840 | 2520 |
| CC64 | PPT1/Palmitoyl-protein thioesterase 1 | Human | Human cells | 760 | 2000 |
| CG26 | PRDX3 | Human | E.coli | 760 | 2280 |
| CP22 | Pre-B-Cell Colony-Enhancing Factor 1/PBEF/Visfatin | Human | E.coli | 760 | 2000 |
| C463 | Pref-1/DLK-1/FA1 | Human | Human cells | 840 | 2520 |
| C254 | Prefoldin subunit 2/PFDN2 | Human | E.coli | 1200 | 3520 |
| CD36 | Pregnancy-specific beta-1-glycoprotein 2 /PSG2/PSBG2 |
Human | Human cells | 1200 | 3520 |
| CJ22 | Prion-like protein doppel/PRND | Human | Human cells | 840 | 2520 |
| CJ31 | PRKAR1A/TSE1 | Human | Human cells | 400 | 840 |
| C923 | PRKG1/cGMP-dependent protein kinase 1 | Human | Human cells | 1200 | 3520 |
| CC65 | Probable serine carboxypeptidase CPVL | Human | Human cells | 1200 | 3520 |
| CA69 | Proenkephalin-A/PENK | Human | Human cells | 1200 | 3520 |
| CG75 | Profilin-2/PFN2 | Human | E.coli | 360 | 840 |
| C754 | Programmed cell death protein 1/PDCD1 | Human | Human cells | 760 | 2000 |
| CM59 | Prolactin Receptor/PRLR (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM58 | Prolactin Receptor/PRLR (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| CI44 | Promotilin/MLN | Human | Human cells | 1200 | 3520 |
| CH86 | Pro-Neuregulin-1(177-241) | Human | E.coli | 840 | 2520 |
| CH83 | Pro-neuregulin-1/NRG1‑beta 1 | Human | E.coli | 400 | 840 |
| CH84 | Pro-neuregulin-1/NRG1‑beta 1(N-polyHis) | Human | E.coli | 400 | 840 |
| CA89 | Proprotein Convertase 9/PCSK9 (D374Y) | Human | Human cells | 840 | 2520 |
| C420 | Prostatic Acid Phosphatase/ACPP | Human | Human cells | 1200 | 3520 |
| CH72 | Protachykinin-1/TAC1 | Human | E.coli | 1200 | 3520 |
| C833 | Protamine-2/PRM2 | Human | Human cells | 1200 | 3520 |
| CM14 | Protein CREG1/CREG | Mouse | Human Cells | 840 | 2520 |
| C255 | Protein CutA/CUTA | Human | E.coli | 1200 | 3520 |
| CF56 | Protein Disulfide Isomerase/P4HB/ERBA2L/PDI/PDIA1/PO4DB | Human | E.coli | 760 | 2000 |
| CA58 | Protein disulfide-isomerase A4/PDIA4 | Human | Human cells | 840 | 2520 |
| C526 | Protein disulfide-isomerase A6/PDIA6 | Human | Human cells | 840 | 2520 |
| CE32 | Protein Dr1/DR1/NC2-beta | Human | E.coli | 840 | 2520 |
| C165 | Protein kinase C epsilon type/PKCE | Human | E.coli | 840 | 2520 |
| C162 | Protein phosphatase 1 regulatory subunit 14A/CPI-17 | Human | E.coli | 840 | 2520 |
| C160 | Protein phosphatase 1G/PP1MG | Human | E.coli | 840 | 2520 |
| CG16 | Protein S100-A13/S100A13 | Human | E.coli | 760 | 2000 |
| C777 | protein tyrosine phosphatase type IVA 2/PTP4A2 | Human | E.coli | 760 | 2000 |
| C628 | Proteinase 3/Myeloblastin/PRTN3 | Human | Human cells | 840 | 2520 |
| C892 | Proteoglycan 3/PRG3 | Human | Human cells | 840 | 2520 |
| C629 | Protocadherin-10 | Human | Human cells | 720 | 2000 |
| CB81 | PRSS1/Trypsin 1 | Human | Human cells | 1200 | 3520 |
| CC90 | PSG3/Pregnancy-specific beta-1-glycoprotein 3 | Human | Human cells | 1200 | 3520 |
| CC62 | PSG5/PS-beta-G-5/PSBG-5 | Human | Human cells | 1200 | 3520 |
| CB23 | PSG9/PSG11 | Human | Human cells | 1200 | 3520 |
| C167 | PSP/Phosphoserine phosphatase | Human | E.coli | 840 | 2520 |
| C010 | PTH 1-84/Parathyroid hormone/Parathormone | Human | E.coli | 840 | 2520 |
| CJ55 | PTH1R/PTHR1 | Human | Human cells | 720 | 2000 |
| CF16 | PTHLH/PTHrP/PTH related protein | Human | E.coli | 1200 | 3520 |
| C168 | PTP1C/PTPN6 | Human | E.coli | 1200 | 3520 |
| CH80 | PTPRN(576-950) |
Human | E.coli | 1200 | 3520 |
| CH82 | PTPRN(578-859) | Human | E.coli | 1200 | 3520 |
| CH78 | PTPRN(687-979) |
Human | E.coli | 1200 | 3520 |
| CJ19 | PVRL4/Nectin-4/PRR4/LNIR | Human | Human cells | 720 | 2000 |
| CH81 | Pyruvate kinase PKM/PKM2 | Human | E.coli | 560 | 1560 |
| C257 | QAPRTase/QPRT |
Human | E.coli | 1200 | 3520 |
| CS23 | RANK/TNFRSF11A | Mouse | Human Cells | 760 | 2000 |
| CK64 | RANK/TNFRSF11A/CD265 | Human | Human cells | 720 | 2000 |
| CJ94 | RANKL/OPGL/TNFSF11/CD254 | Mouse | Human cells | 1200 | 3520 |
| C169 | RBP4/Retinol-Binding Protein 4 | Human | E.coli | 640 | 1760 |
| CP69 | Receptor Tyrosine-Protein Kinase ErbB-2/HER2 (C-6His) | Human | Human cells | 760 | 2000 |
| C530 | Reg1A/Lithostathine-1-alpha | Human | Human cells | 840 | 2520 |
| CJ37 | Reg2/Lithostathine-2 | Mouse | Human cells | 840 | 2520 |
| CC77 | REG3G/Regenerating islet-derived protein 3-gamma | Human | Human cells | 1200 | 3520 |
| CD30 | REG4/GISP/RELP/Regenerating islet-derived protein 4 | Human | Human cells | 760 | 2000 |
| CB80 | RELT/TNFRSF19L | Human | Human cells | 760 | 2000 |
| CJ48 | Resistin/ADSF/RETN | Human | Human cells | 760 | 2280 |
| CJ57 | Resistin/ADSF/RETN | Mouse | Human cells | 720 | 2000 |
| CG51 | Resistin/RETN | Human | E.coli | 760 | 2280 |
| CD95 | Retbindin/RTBDN | Human | Human cells | 1200 | 3520 |
| CA44 | Reticulocalbin-3/RCN3 | Human | Human cells | 840 | 2520 |
| CG56 | Reticulon-4/RTN4/NOGO | Human | E.coli | 760 | 2000 |
| CJ21 | Retinoic acid receptor responder protein 2/Chemerin | Human | Human cells | 840 | 2520 |
| CR20 | Retinoid-binding Protein 7 | Human | E.coli | 760 | 2000 |
| CP74 | Retinol-binding Protein 2 | Human | E.coli | 760 | 2000 |
| CR18 | Retinol-Binding Protein 3 (N-6His) | Human | E.coli | 760 | 2000 |
| CR19 | Retinol-binding Protein 5 | Human | E.coli | 760 | 2000 |
| C228 | r-Glutamylaminecyclotransferase/Ggact | Human | E.coli | 1200 | 3520 |
| C214 | r-Glutamylcyclotransferase/Ggct | Human | E.coli | 1200 | 3520 |
| CH40 | RGMA/Repulsive guidance molecule A | Human | E.coli | 760 | 2000 |
| CG22 | RHEB/RHEB2 | Human | E.coli | 1200 | 3520 |
| C804 | Ribose-phosphate pyrophosphokinase 2/PRPS2 | Human | Human cells | 840 | 2520 |
| C772 | Ribosomal protein S6 kinase alpha-1/RPS6KA1 | Human | Human cells | 1200 | 3520 |
| CF37 | Ribulose-phosphate 3-epimerase/RPE | Human | E.coli | 840 | 2520 |
| CM26 | RNA Pyrophosphohydrolase/rppH | E.coli | E.coli | 840 | 2520 |
| CA30 | Rnase 1 | Human | Human cells | 1200 | 3520 |
| CA06 | Rnase 3/ECP | Human | Human cells | 1200 | 3520 |
| CA50 | Rnase 6 | Human | Human cells | 840 | 2520 |
| CI28 | Rnase T2/Ribonuclease T2 | Human | Human cells | 1200 | 3520 |
| C770 | Roundabout homolog 4/ROBO4 | Human | Human cells | 760 | 2000 |
| C170 | RPS19/40S ribosomal protein S19 | Human | E.coli | 840 | 2520 |
| CH74 | RPS7/40S ribosomal protein S7 | Human | E.coli | 1200 | 3520 |
| CD83 | R-spondin-1/RSPO1 | Human | Human cells | 840 | 2520 |
| CB79 | R-spondin-3/RSPO3 | Human | Human cells | 840 | 2520 |
| CP24 | S100 Calcium Binding Protein A15A/S100A15A | Mouse | E.coli | 760 | 2000 |
| CK82 | S100 Calcium Binding Protein B/S100B | Mouse | E.coli | 760 | 2000 |
| CM19 | S100 Calcium Binding Protein B/S100B | Human | E.coli | 600 | 1440 |
| C743 | S100A12/Protein S100-A12/EN-RAGE | Human | E.coli | 760 | 2000 |
| CH98 | S100A6/Protein S100-A6 | Human | E.coli | 400 | 1200 |
| C794 | S100A8/Protein S100-A8 | Human | E.coli | 400 | 1200 |
| C796 | S100A8/S100A9 Heterodimer | Human | E.coli | 840 | 2520 |
| C795 | S100-A9/Protein S100-A9 | Human | E.coli | 400 | 840 |
| C258 | S100P/S100 calcium-binding protein P | Human | E.coli | 1200 | 3520 |
| CP14 | Scavenger Receptor B2/SR-B2/LIMPII/CD36L2 (C-Fc) | Mouse | Human Cells | 760 | 2000 |
| CP13 | Scavenger Receptor B2/SR-B2/LIMPII/CD36L2 (N-6His) | Mouse | Human Cells | 760 | 2000 |
| C532 | Scavenger Receptor Class B Member 2/Scarb2 | Human | Human cells | 1024 | 3080 |
| CC82 | SCG2/Secretogranin-2 | Human | Human cells | 760 | 2000 |
| CE52 | SCL/Tal1 | Human | E.coli | 1200 | 3520 |
| CD48 | Sclerostin/SOST | Human | Human cells | 1200 | 3520 |
| C259 | SCO1/SCOD1 | Human | E.coli | 1200 | 3520 |
| CJ11 | SDC4/Syndecan-4/SYND4/Ryudocan core protein | Mouse | Human cells | 400 | 1200 |
| C674 | Secretagogin/SCGN | Human | Human cells | 840 | 2520 |
| CA49 | Secreted and transmembrane protein 1/SECTM1/K12 | Human | Human cells | 720 | 2000 |
| CI78 | Secretogranin-3/SCG3 | Human | Human cells | 400 | 1200 |
| C654 | Secretory lectin ZG16/ZG16 | Human | Human cells | 1200 | 3520 |
| CI92 | Sedoheptulokinase/SHPK/CARKL | Human | Human cells | 1200 | 3520 |
| CI93 | Selenophosphate synthase 1/SEPHS1 | Human | Human cells | 1200 | 3520 |
| CJ08 | SEMA4D/Semaphorin-4D/CD100/Semacl2/Semaj | Mouse | Human cells | 720 | 2000 |
| CD65 | Semaphorin 3A/SEMA3A/SEMAD | Human | Human cells | 840 | 2520 |
| C636 | Semaphorin 3C/SEMA3C | Human | Human cells | 560 | 1680 |
| CI66 | Semaphorin 4A/SEMA4A | Mouse | Human cells | 1200 | 3520 |
| CB69 | Semaphorin 4B/SEMA4B | Human | Human cells | 1200 | 3520 |
| CC34 | Semaphorin 4B/SEMA4B(Fc fusion) | Human | Human cells | 1200 | 3520 |
| CJ70 | Semaphorin 4C | Mouse | Human cells | 1200 | 3520 |
| CI76 | Semaphorin 4D/SEMA4D/CD100 | Human | Human cells | 720 | 2000 |
| CJ67 | Semaphorin 4G/KIAA1619/SEMA4G | Human | Human cells | 720 | 2000 |
| C499 | Semaphorin 5A/SEMA5A | Human | Human cells | 840 | 2520 |
| C638 | Semenogelin-1/SEMG1 | Human | Human cells | 840 | 2520 |
| CH01 | Sentrin-specific protease 2/SENP2 | Human | E.coli | 240 | 720 |
| C171 | Sentrin-specific protease 7/SSP2/SENP7 | Human | E.coli | 840 | 2520 |
| C931 | Serine hydroxymethyltransferase/SHMT1 | Human | Human cells | 1200 | 3520 |
| CJ41 | Serotransferrin/Tf | Human | Human cells | 400 | 1200 |
| C533 | Serpin A1/a1-Antitrypsin | Human | Human cells | 1200 | 3520 |
| CA54 | Serpin A10/PZI | Human | Human cells | 840 | 2520 |
| C192 | Serpin A12/Vaspin | Human | E.coli | 840 | 2520 |
| C695 | Serpin A1b | Mouse | Human cells | 1200 | 3520 |
| C534 | Serpin A3/AACT | Human | Human cells | 1200 | 3520 |
| C535 | Serpin A5/Protein C Inhibitor | Human | Human cells | 1200 | 3520 |
| C639 | Serpin A6 | Human | Human cells | 1200 | 3520 |
| C536 | Serpin A7/T4-binding globulin | Human | Human cells | 840 | 2520 |
| CB56 | Serpin A8/Angiotensinogen | Human | Human cells | 1200 | 3520 |
| CJ01 | Serpin B1/ELANH2/MNEI/PI2 | Human | Human cells | 840 | 2520 |
| CI96 | Serpin B12 | Human | Human cells | 1200 | 3520 |
| CJ63 | Serpin B3/SCCA-1 | Human | Human cells | 1200 | 3520 |
| CM24 | Serpin B3/SERPINB3/SCCA1 | Human | E.coli | 1200 | 3520 |
| CF94 | Serpin B5/Maspin | Human | E.coli | 760 | 2000 |
| CE54 | Serpin B6 | Human | E.coli | 1200 | 3520 |
| CJ32 | Serpin B9 | Human | Human cells | 760 | 2000 |
| CK98 | Serpin D1/Heparin Cofactor II/HCF2 | Mouse | Human Cells | 1200 | 3520 |
| C537 | Serpin E1 | Human | Human cells | 1200 | 3520 |
| C538 | Serpin F1 | Human | Human cells | 840 | 2520 |
| CG77 | Serpin F1/Pigment epithelium-derived factor/PEDF | Mouse | E.coli | 760 | 2280 |
| CM08 | Serpin F2/Alpha-2-Antiplasmin (C-6His) | Mouse | Human Cells | 1200 | 3520 |
| CM07 | Serpin F2/Alpha-2-Antiplasmin (C-Fc) | Mouse | Human Cells | 1200 | 3520 |
| C539 | Serpin G1 | Human | Human cells | 840 | 2520 |
| CJ07 | Serpin G1/Serping1/C1nh | Mouse | Human cells | 1200 | 3520 |
| CJ02 | Serpin I2/Pancpin/MEPI/PI14 | Human | Human cells | 840 | 2520 |
| CP01 | Serum Albumin | Mouse | E.coli | 240 | 720 |
| CF15 | Serum amyloid A /SAA4/CSAA | Human | E.coli | 840 | 2520 |
| C633 | Serum Amyloid A1/SAA1 | Human | E.coli | 1200 | 3520 |
| C640 | SFRP-2/Secreted frizzled-related protein 2 | Human | Human cells | 1024 | 3080 |
| C281 | SGTA | Human | E.coli | 1200 | 3520 |
| CF35 | SH2D1A/SH2 domain-containing protein 1A | Human | E.coli | 760 | 2000 |
| C983 | SH3KBP1/CD2BP3 | Human | Human cells | 1200 | 3520 |
| CA18 | Sialate O-acetylesterase/SIAE | Human | Human cells | 1200 | 3520 |
| C788 | Siglec-9/sialic acid-binding Ig-like lectin 9 | Human | Human cells | 760 | 2000 |
| CS22 | Signaling Lymphocytic Activation Molecule/SLAM/CD150 | Mouse | Human Cells | 760 | 2000 |
| CP67 | Signal-Regulatory Protein α-1/SIRPA/CD172a | Human | Human cells | 760 | 2000 |
| CS12 | Signal-Regulatory Protein α-1/SIRPA/CD172a | Mouse | Human Cells | 560 | 1680 |
| CP68 | Signal-Regulatory Protein α-1/SIRPA/CD172a (C-Fc) | Mouse | Human cells | 760 | 2000 |
| CP70 | Signal-Regulatory Protein α-1/SIRPA/CD172a (C-MIgG2a) | Mouse | Human cells | 760 | 2000 |
| CC63 | SIL1/Nucleotide exchange factor SIL1 | Human | Human cells | 840 | 2520 |
| CG10 | SIRPG/SIRPB2 | Human | Human cells | 760 | 2000 |
| C292 | SIT1 | Human | E.coli | 1200 | 3520 |
| CS51 | SLAM Family Member 2/CD48 | Mouse | Human cells | 760 | 2000 |
| CK72 | SLAM Family Member 5/SLAMF5/CD84 | Mouse | Human Cells | 760 | 2000 |
| C771 | SLAMF8/SLAM family member 8/BLAME | Human | Human cells | 760 | 2000 |
| C789 | SLAMF9/SLAM family member 9 | Mouse | Human cells | 760 | 2000 |
| CE81 | SMAD1/SMAD family member 1 | Human | E.coli | 1200 | 3520 |
| CF52 | SMAD4/SMAD family member 4 | Human | E.coli | 360 | 2280 |
| CM73 | Small Ubiquitin-Related Modifier 3/SUMO3/SMT3A (C-6His) | Human | Human Cells | 480 | 1200 |
| CD61 | SMPDL3A/ASM-like phosphodiesterase 3a | Human | Human cells | 1200 | 3520 |
| CF66 | SNCA/Alpha-synuclein | Human | E.coli | 240 | 720 |
| CF67 | SNCG/Gamma-synuclein | Human | E.coli | 240 | 720 |
| CE19 | SOD1/Cu-Zn SOD | Human | E.coli | 1200 | 3520 |
| C677 | SOD2/Mn-SOD | Human | E.coli | 1200 | 3520 |
| CB01 | SOD2/Mn-SOD | Human | Human cells | 760 | 2000 |
| CM32 | Soluble Interferon α/β receptor B18 | Vaccinia virus | Human Cells | 1200 | 3520 |
| C100 | Sonic Hedgehog/Shh | Human | E.coli | 936 | 2800 |
| CH69 | Sonic Hedgehog/Shh | Mouse | E.coli | 840 | 2520 |
| C089 | Sonic Hedgehog/Shh (C24II) | Human | E.coli | 840 | 2520 |
| CH66 | Sonic Hedgehog/Shh (C25II) | Mouse | E.coli | 840 | 2520 |
| C885 | Sorbitol dehydrogenase/SORD | Human | Human cells | 1200 | 3520 |
| C421 | SP-10/ACRV1 | Human | Human cells | 840 | 2520 |
| C541 | SP-D/Pulmonary surfactant-associated protein D | Human | Human cells | 640 | 1760 |
| C683 | Sperm equatorial segment protein 1/SPESP1 | Human | Human cells | 1200 | 3520 |
| C542 | SPINK1/Pancreatic secretory trypsin inhibitor/PST1 | Human | Human cells | 840 | 2520 |
| C543 | SPINK4/Serine protease inhibitor Kazal-type | Human | Human cells | 840 | 2520 |
| CJ18 | SPINK7/ECRG-2/ECG2 | Human | Human cells | 1200 | 3520 |
| CM63 | Spondin 2/SPON2/Mindin | Human | Human Cells | 600 | 1440 |
| C942 | SRPK2/SRSF protein kinase 2 | Human | Human cells | 1200 | 3520 |
| C500 | ST6 Gal Sialyltransferase 1/ST6GAL1 | Human | Human cells | 1200 | 3520 |
| C667 | ST6 Sialyltransferase 2/ST6GALNAC2 | Human | Human cells | 1200 | 3520 |
| C389 | ST7/LRP12 | Human | Human cells | 640 | 1760 |
| C682 | ST8SIA1/alpha-2,8-Sialyltransferase 8A | Human | Human cells | 1200 | 3520 |
| CF22 | STAT1 | Human | E.coli | 840 | 2520 |
| CF29 | STAT3 | Human | E.coli | 1200 | 3520 |
| CG38 | STAT5B | Human | E.coli | 1200 | 3520 |
| CG37 | STAT6 | Human | E.coli | 1200 | 3520 |
| C174 | Stathmin/STMN1 | Human | E.coli | 840 | 2520 |
| C775 | stem cell factor/SCF | Mouse | E.coli | 1200 | 3520 |
| CG82 | Sterol O-acyltransferase 2/SOAT2/ACAT2 | Human | E.coli | 1200 | 3520 |
| CF99 | STN1/CST complex subunit STN1/OBFC1 | Human | E.coli | 1200 | 3520 |
| C173 | Stratifin/SFN/14-3-3 protein σ | Human | E.coli | 840 | 2520 |
| C698 | Stromal cell-derived factor 1/CXCL12 | Mouse | E.coli | 840 | 2520 |
| C115 | STUB1/CHIP | Human | E.coli | 840 | 2520 |
| CA15 | Sulfamidase/SGSH | Human | Human cells | 1200 | 3520 |
| C501 | Sulfatase Modifying Factor 1/SUMF1 | Human | Human cells | 840 | 2520 |
| CE94 | Sulfotransferase 1A2/SULT1A2/STP2 | Human | E.coli | 760 | 2280 |
| CF91 | Sulfotransferase 1C4/SULT1C2 | Human | E.coli | 760 | 2000 |
| CF97 | SULT1A1/Cytosolic Sulfotransferase 1A1 | Human | E.coli | 1200 | 3520 |
| CG03 | SULT1A3/Cytosolic Sulfotransferase 1A3 | Human | E.coli | 1200 | 3520 |
| CF90 | SULT1B1/Cytosolic Sulfotransferase 1B1 | Human | E.coli | 1200 | 3520 |
| CK03 | SULT1C4/Sulfotransferase/SULT1C2 | Human | E.coli | 840 | 2520 |
| CF92 | SULT2A1/Cytosolic Sulfotransferase 2A1 | Human | E.coli | 760 | 2280 |
| CE93 | SULT2B1/Cytosolic Sulfotransferase 2B1 | Human | E.coli | 760 | 2000 |
| CF71 | SULT4A1/Cytosolic Sulfotransferase 4A1 | Human | E.coli | 1200 | 3520 |
| C175 | SUMO1/Small ubiquitin-related modifier 1 | Human | E.coli | 80 | 240 |
| C176 | SUMO2/Small ubiquitin-related modifier 2 | Human | E.coli | 80 | 240 |
| CH11 | SUMO3/SMT3B/SMT3H1 | Human | E.coli | 240 | 720 |
| CE04 | SUMO3/SMT3B/SMT3H1(C-polyHis) | Human | E.coli | 80 | 240 |
| CH22 | SWSAP1/C19orf39 | Human | E.coli | 1200 | 3520 |
| CF77 | Synaptobrevin homolog YKT6/YkT6 | Human | E.coli | 1200 | 3520 |
| C635 | Syndecan-2/SDC2 | Human | Human cells | 560 | 1680 |
| C776 | syndecan-binding protein 1/SDCBP | Mouse | E.coli | 1200 | 3520 |
| CF19 | Syntaxin-6/STX6 | Human | E.coli | 1200 | 3520 |
| CK85 | Syntaxin-7/STX7 | Human | Human Cells | 760 | 2000 |
| CG63 | Syntaxin-8/STX8 | Human | E.coli | 760 | 2000 |
| CG46 | Syntenin-1/SDCBP/SYCL/MDA9 | Human | E.coli | 760 | 2280 |
| CK23 | Synuclein‑ alpha/SNCA | Mouse | E.coli | 1200 | 3520 |
| CM54 | T Cell Immunoglobulin and Mucin Domain-3/TIM-3/HAVCR2 (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM03 | T Cell Immunoglobulin and Mucin Domain-3/TIM-3/HAVCR2 (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| CM64 | T Cell Immunoglobulin and Mucin Domain-3/TIM3HAVCR2 | Marmoset | Human Cells | 600 | 1440 |
| CG30 | Tachykinin-3/TAC3 | Human | E.coli | 760 | 2000 |
| CJ54 | TACI/TNFRSF13B/CD267 | Mouse | Human cells | 720 | 2000 |
| C177 | Tau/Microtubule-associated protein tau(C-polyHis) | Human | E.coli | 840 | 2520 |
| CH19 | tau-F protein/Microtubule-associated protein tau | Human | E.coli | 840 | 2520 |
| CS15 | T-cell immunoreceptor with Ig and ITIM domains/TIGIT | Mouse | Human cells | 760 | 2000 |
| CP64 | T-cell Surface Protein Tactile/CD96 | Human | Human cells | 240 | 720 |
| CP65 | T-cell Surface Protein Tactile/CD96 | Mouse | Human cells | 760 | 2000 |
| CS52 | T-cell Surface Protein Tactile/CD96(C-Fc) | Human | Human cells | 240 | 720 |
| CI67 | T-cell-specific surface glycoprotein CD28/CD28 | Mouse | Human cells | 240 | 640 |
| C529 | TEM7/PLXDC1 | Human | Human cells | 840 | 2520 |
| C762 | Teratocarcinoma-derived growth factor 1/TDGF1 | Human | Human cells | 1200 | 3520 |
| CI13 | Testican-3/SPOCK3 | Mouse | Human cells | 760 | 2000 |
| CE60 | Testin/TES | Human | E.coli | 840 | 2520 |
| C878 | TFF2/Trefoil factor 2 | Human | Human cells | 840 | 2520 |
| C390 | TFPI-2/Tissue factor pathway inhibitor 2 | Human | Human cells | 1200 | 3520 |
| C178 | TGF-alpha/TGFa | Human | E.coli | 320 | 960 |
| CA59 | TGF-beta 1/TGFB1 | Human | Human cells | 840 | 2520 |
| CK33 | TGF-beta 1/TGFB1 | Mouse | Human cells | 1200 | 3520 |
| CJ79 | TGF-beta 2/TGFB2 | Human | Human cells | 1200 | 3520 |
| CK35 | TGF-beta 2/TGFB2 | Mouse | Human cells | 1200 | 3520 |
| CJ44 | TGF-beta 3/TGFB3 | Human | Human cells | 1200 | 3520 |
| CC10 | TGFBR2/TGF-beta receptor type-2 | Human | Human cells | 840 | 2520 |
| CI15 | TGM2/Transglutaminase-2/TGase C |
Mouse | Human cells | 1200 | 3520 |
| CC69 | TGOLN2/Trans-Golgi network integral membrane protein 2 | Human | Human cells | 1200 | 3520 |
| CI73 | Thiamin pyrophosphokinase 1/TPK1 | Human | Human cells | 760 | 2000 |
| C179 | Thimet Oligopeptidase/THOP1 | Human | E.coli | 1200 | 3520 |
| C182 | Thioredoxin 2 | Human | E.coli | 840 | 2520 |
| C673 | Thioredoxin domain-containing protein 12/TXNDC12 | Human | Human cells | 1200 | 3520 |
| CE85 | Thioredoxin/TXN | Human | E.coli | 360 | 840 |
| CH30 | Thioredoxin-related transmembrane protein 2/TMX2 |
Human | E.coli | 1200 | 3520 |
| CP40 | Thrombopoietin/THPO/TPO | Mouse | Human Cells | 1200 | 3520 |
| CJ95 | Thrombopoietin/TPO | Human | Human cells | 1200 | 3520 |
| C646 | THSD1/TMTSP | Human | Human cells | 320 | 960 |
| CJ69 | Thymic stromal lymphopoietin/TSLP | Mouse | Human cells | 720 | 2000 |
| CI64 | Thymidine kinase, cytosolic/TK1 | Human | Human cells | 1200 | 3520 |
| CI65 | Thymidylate kinase/DTYMK | Human | Human cells | 1200 | 3520 |
| C180 | Thymopoietin | Human | E.coli | 840 | 2520 |
| CP02 | TIGIT/VSIG9/VSTM3 | Human | P.Pichia | 760 | 2000 |
| CJ58 | TIGIT/VSTM3 | Human | Human cells | 1200 | 3520 |
| CK55 | TIGIT/VSTM3 | Mouse | Human Cells | 760 | 2000 |
| C260 | TIM/TPI1 | Human | E.coli | 1200 | 3520 |
| CK57 | Tim-3/Havcr2 | Mouse | Human Cells | 760 | 2000 |
| CD71 | TIM-3/TIMD3/HAVCR2(Fc fusion) | Human | Human cells | 560 | 1680 |
| C456 | TIMP-1/Metalloproteinase inhibitor 1 | Human | Human cells | 1200 | 3520 |
| C459 | TIMP-2/Metalloproteinase inhibitor 2 | Human | Human cells | 1200 | 3520 |
| CJ60 | TIMP-4/Tissue inhibitor of metalloproteinases 4 | Human | Human cells | 1200 | 3520 |
| CB22 | TINAGL1/Tubulointerstitial nephritis antigen-like | Human | Human cells | 1200 | 3520 |
| CM11 | Tissue Inhibitors of Metalloproteinases 1/TIMP1 | Mouse | Human Cells | 1200 | 3520 |
| CP55 | T-lymphocyte Activation Antigen CD80/B7-1/CD80 (C-6His) | Mouse | Human cells | 400 | 720 |
| CP54 | T-lymphocyte Activation Antigen CD80B7-1/CD80 | Cynomologous monkey | Human cells | 400 | 720 |
| CP56 | T-lymphocyte activation antigen CD80B7-1/CD80 | Rat | Human cells | 760 | 2000 |
| CP57 | T-lymphocyte activation antigen CD80B7-1/CD80 | Rabbit | Human cells | 400 | 720 |
| CP41 | T-lymphocyte Activation Antigen CD86/B7-2/CD86 | Cynomologous monkey | Human cells | 400 | 920 |
| CP42 | T-lymphocyte activation antigen CD86/B7-2/CD86 | Rabbit | Human cells | 600 | 1200 |
| CP44 | T-lymphocyte Activation Antigen CD86/B7-2/CD86 (C-6His) | Mouse | Human cells | 400 | 1200 |
| CP43 | T-lymphocyte activation antigen CD86/B7-2/CD866 | Rat | Human cells | 600 | 1200 |
| CD34 | TMIGD2/IGPR1 | Human | Human cells | 1200 | 3520 |
| C821 | TMPRSS11B/Transmembrane protease serine 11B | Human | Human cells | 1200 | 3520 |
| CS34 | TNF ligand superfamily member 9/TNFSF9 | Mouse | Human cells | 936 | 2800 |
| CI39 | TNF RII/TNFRSF1B | Human | Human cells | 840 | 2520 |
| CG90 | TNF/TNFa/TNFSF2(C-polyHis) | Human | E.coli | 360 | 840 |
| CG91 | TNF/TNFa/TNFSF2(N-polyHis) | Human | E.coli | 1200 | 3520 |
| C008 | TNFa/TNFSF2 | Human | E.coli | 480 | 960 |
| C082 | TNFa/TNFSF2 | Rabbit | E.coli | 936 | 2800 |
| CF09 | TNFa/TNFSF2 | Mouse | E.coli | 840 | 2520 |
| C036 | TNFa/TNFSF2 (high active) | Human | E.coli | 800 | 2320 |
| C181 | TNFb/TNFSF1B | Human | E.coli | 936 | 2800 |
| CM93 | TNF-Like 1/TL1A/TNFSF15 | Mouse | E.coli | 1200 | 3520 |
| CI97 | TNFRSF10B/MK/CD262/Dr5/Killer | Mouse | Human cells | 760 | 2000 |
| C504 | TNFRSF10C/TRAIL R3 | Human | Human cells | 320 | 960 |
| C689 | TNFRSF1A | Human | E.coli | 840 | 2520 |
| C694 | TNFRSF1B | Mouse | Human cells | 760 | 2000 |
| C782 | TNFRSF1B | Human | Human cells | 840 | 2520 |
| CJ74 | TNFRSF25/DR3/TNFRSF12 | Human | Human cells | 720 | 2000 |
| CD38 | TNFRSF3/LTBR/TNFR3(Fc fusion) | Human | Human cells | 360 | 840 |
| CK52 | TNFRSF4/OX40/CD134 | Mouse | Human Cells | 760 | 2000 |
| CK53 | TNFRSF4/OX40/CD134(Fc fusion) | Mouse | Human Cells | 760 | 2000 |
| CK58 | TNFRSF4/OX40/CD134(Fc fusion) | Human | Human Cells | 760 | 2280 |
| CK54 | TNFRSF4/OX40/CD134(N-Fc fusion) | Mouse | Human Cells | 760 | 2000 |
| CK59 | TNFRSF4/OX40/CD134(N-Fc fusion) | Human | Human Cells | 760 | 2280 |
| CM80 | TNFRSF8/CD30L Receptor/CD30 | Human | Human Cells | 520 | 1200 |
| CS39 | TNFRSF8/CD30L Receptor/CD30 | Mouse | Human cells | 400 | 840 |
| CJ38 | TNFRSF9/4-1BB/CD137 | Human | Human cells | 400 | 840 |
| CI69 | TNFRSF9/41BB/CD137 | Mouse | Human cells | 720 | 2000 |
| C022 | TNFSF10/TRAIL/APO-2L | Human | E.coli | 400 | 1120 |
| CG92 | TNFSF10/TRAIL/APO-2L(C-polyHis) | Human | E.coli | 360 | 840 |
| C038 | TNFSF15/VEGI 192 | Human | E.coli | 936 | 2800 |
| CI05 | TNFSF18/AITRL | Human | Human cells | 840 | 2520 |
| CH04 | TNFSF9/TNF ligand superfamily member 9/4-1BBL | Human | E.coli | 840 | 2520 |
| CE59 | Tollip/Toll-interacting protein | Human | E.coli | 1200 | 3520 |
| CK01 | Toxin B | Vibrio cholerae | E.coli | 1200 | 3520 |
| CD67 | tPA/Tissue-type plasminogen activator/PLAT | Human | Human cells | 1200 | 3520 |
| CR06 | TRANCE/RANK L/TNFSF11 | Mouse | E.coli | 1200 | 3520 |
| CK63 | TRANCE/RANK L/TNFSF11/CD254 | Human | E.coli | 1200 | 3520 |
| C837 | Transaldolase/TALDO1 | Human | Human cells | 1200 | 3520 |
| C293 | Transcription initiation factor IIB/GTF2B | Human | E.coli | 1200 | 3520 |
| CF20 | Transcriptional Repressor Ctcf/Ctcf | Human | E.coli | 1200 | 3520 |
| CM05 | Transforming Growth Factor-β Receptor Type II/TGFBR2 (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CM04 | Transforming Growth Factor-β Receptor Type II/TGFBR2 (C-Fc) | Mouse | Human Cells | 600 | 1440 |
| C545 | Transthyretin/ATTR | Human | Human cells | 936 | 2800 |
| C506 | TREM-1 | Human | Human cells | 560 | 1680 |
| C391 | TREML1/TLT-1 | Human | Human cells | 560 | 1680 |
| CM67 | TREML2/TLT-2 (C-6His) | Mouse | Human Cells | 600 | 1440 |
| CD07 | Trem-like transcript 1 protein/TREML1/TLT1 | Human | Human cells | 760 | 2000 |
| CC39 | Trem-like transcript 2 protein/TREML2/C6orf76 | Human | Human cells | 760 | 2000 |
| CM92 | Triggering Receptor Expressed on Myeloid Cells 2b/TREM-2b (C-6His) | Mouse | Human cells | 760 | 2000 |
| CM91 | Triggering Receptor Expressed on Myeloid Cells 2b/TREM-2b (C-Fc) | Mouse | Human cells | 760 | 2000 |
| CF17 | TRIM/TCRIM | Human | E.coli | 1200 | 3520 |
| CH37 | Tripartite motif-containing protein 5/TRIM5/RNF88 | Human | E.coli | 1200 | 3520 |
| CA36 | Tripeptidyl-Peptidase I/TPP1 | Human | Human cells | 1200 | 3520 |
| C507 | TrkB/NTRK2 | Human | Human cells | 320 | 960 |
| CF21 | Tropomyosin alpha-3 chain/TPM3 | Human | E.coli | 840 | 2520 |
| C261 | Tropomyosin α-1 chain/TPM1 | Human | E.coli | 1200 | 3520 |
| C505 | Tryptase beta-2/TPSB2 | Human | Human cells | 1200 | 3520 |
| C383 | Tryptase epsilon/BSSP-4 | Human | Human cells | 1200 | 3520 |
| CG32 | Tryptophan 5-hydroxylase 2/TPH-2 | Human | E.coli | 1200 | 3520 |
| CM75 | Tryptophan Synthase | E.coli | E.coli | 840 | 2520 |
| CM30 | Tryptophan Synthase α chain/Trp A | E.coli | E.coli | 840 | 2520 |
| CM31 | Tryptophan Synthase β chain/Trp B | E.coli | E.coli | 840 | 2520 |
| CK16 | TSLP | Human | E.coli | 1200 | 3520 |
| CK36 | TSLP R | Mouse | Human cells | 1200 | 3520 |
| CK37 | TSLP R(Fc fusion) | Mouse | Human cells | 1200 | 3520 |
| CD87 | Tsukushin/TSKU | Human | Human cells | 760 | 2000 |
| CG33 | Tubulin beta-4 chain/TUBB4 |
Human | E.coli | 1200 | 3520 |
| CP72 | Tumor Necrosis Factor Ligand 2B/OX40L | Cynomolgus monkey | Human cells | 1440 | 4320 |
| CP04 | Tumor Necrosis Factor Receptor I/TNFRSF1A/CD120a (C-Fc) | Mouse | Human cells | 760 | 2000 |
| CP11 | Tumor Necrosis Factor Receptor II/TNFRSF1B/CD120b | Human | Human Cells | 760 | 2000 |
| CS43 | Tumor Necrosis Factor Receptor Superfamily Member 5/CD40 | Mouse | Human cells | 760 | 2000 |
| C392 | TWSG1/TSG | Human | Human cells | 936 | 2800 |
| CG41 | TXLNA/α-taxilin | Human | E.coli | 1200 | 3520 |
| CI27 | TXNDC15/Thioredoxin domain-containing protein 15 | Human | Human cells | 1200 | 3520 |
| CJ47 | TYRO3/Tyrosine-protein kinase receptor TYRO3 | Mouse | Human cells | 400 | 840 |
| CF54 | Tyrosine-protein kinase Blk/BLK | Human | E.coli | 840 | 2520 |
| C502 | Tyrosine-protein kinase receptor Tie-1 |
Human | Human cells | 320 | 960 |
| CK68 | Tyrosine-Protein Kinase Receptor TYRO3/DTK | Mouse | Human Cells | 240 | 720 |
| C262 | U6 snRNA-Associated Sm-Like Protein LSm1/LSM1 | Human | E.coli | 1200 | 3520 |
| CE46 | UBAP1/Ubiquitin-associated protein 1/NAG20 | Human | E.coli | 1200 | 3520 |
| CF30 | UBC9/UBCE9/UBE2I/SUMO-conjugating enzyme UBC9 | Human | E.coli | 360 | 840 |
| C183 | UBE2A/HR6A | Human | E.coli | 240 | 600 |
| CF58 | UBE2B/HR6B | Human | E.coli | 840 | 2520 |
| CF41 | UBE2C/Ubiquitin-conjugating enzyme E2 C(N-polyHis) | Human | E.coli | 760 | 2280 |
| CG01 | UBE2C/Ubiquitin-conjugating enzyme E2 C/UBCH10 | Human | E.coli | 760 | 2280 |
| CH10 | UBE2D3/Ubiquitin-conjugating enzyme E2 D3/UBC5C/UBCH5C | Human | E.coli | 240 | 720 |
| C184 | UBE2D4/Ubiquitin-conjugating enzyme E2 D4/UbcH5d | Human | E.coli | 240 | 600 |
| CE09 | UBE2G2/Ubiquitin-conjugating enzyme E2 G2 | Human | E.coli | 240 | 640 |
| C185 | UBE2H/Ubiquitin-conjugating enzyme E2 H/UbcH2 | Human | E.coli | 240 | 600 |
| CE31 | UBE2J2/Ubiquitin-conjugating enzyme E2 J2 | Human | E.coli | 1200 | 3520 |
| CG45 | UBE2K/Ubiquitin-conjugating enzyme E2 K | Human | E.coli | 240 | 720 |
| C186 | UBE2K/Ubiquitin-conjugating enzyme E2 K/E2-25K(GST) | Human | E.coli | 240 | 600 |
| CG31 | UBE2L6/Ubiquitin/ISG15-conjugating enzyme E2 L6/UBCH8 | Human | E.coli | 760 | 2000 |
| CG49 | UBE2M/NEDD8-conjugating enzyme Ubc12/UBC12 | Human | E.coli | 240 | 720 |
| C289 | UBE2S/Ubiquitin-conjugating enzyme E2 S | Human | E.coli | 240 | 640 |
| C187 | UBE2T/Ubiquitin-conjugating enzyme E2 T | Human | E.coli | 240 | 600 |
| CG36 | UBE2V1/Uev1a (Mms2) | Human | E.coli | 400 | 800 |
| CG24 | UBE2V2/DDVIT1/EDPF1 | Human | E.coli | 760 | 2280 |
| CG35 | UBE2Z/Ubiquitin-conjugating enzyme E2 Z | Human | E.coli | 400 | 800 |
| C591 | Ubiquinone biosynthesis protein COQ7 homolog/COQ7 | Human | Human cells | 840 | 2520 |
| C191 | Ubiquitin carboxyl-terminal hydrolase 14/USP14 | Human | E.coli | 560 | 2120 |
| C188 | Ubiquitin carboxyl-terminal hydrolase isozyme L1/UCH-L1 | Human | E.coli | 400 | 1120 |
| C189 | Ubiquitin carboxyl-terminal hydrolase isozyme L3/UCH-L3 | Human | E.coli | 1024 | 3080 |
| C242 | Ubiquitin Thioesterase Otub2/Otub2 | Human | E.coli | 1200 | 3520 |
| CH56 | Ubiquitin-conjugating enzyme E2 D1/UBE2D1/UBCH5 | Human | E.coli | 200 | 680 |
| CG23 | Ubiquitin-Conjugating Enzyme E2 R2/Ube2R2 | Human | E.coli | 400 | 800 |
| CH07 | Ubiquitin-like modifier-activating enzyme 5/UBA5 | Human | E.coli | 840 | 2520 |
| CG48 | Ubiquitin-like protein Nedd8/NEDD8 | Human | E.coli | 160 | 360 |
| C263 | UDP-glucose 4-epimerase/GALE | Human | E.coli | 1200 | 3520 |
| C190 | UGRP1/SCGB3A2 | Human | E.coli | 840 | 2520 |
| CJ87 | ULBP1 | Mouse | Human cells | 720 | 2000 |
| CK50 | ULBP1/RAET1/N2DL1(Fc fusion) | Human | Human Cells | 760 | 2000 |
| CG76 | Unique cartilage matrix-associated protein/UCMA/C10orf49 | Human | E.coli | 1200 | 3520 |
| CA24 | UPA/PRAP1 | Human | Human cells | 840 | 2520 |
| C382 | uPAR/CD87 | Human | Human cells | 840 | 2520 |
| C393 | u-Plasminogen Activator/PLAU | Human | Human cells | 1200 | 3520 |
| CG72 | Uracil phosphoribosyltransferase homolog/UPRT | Human | E.coli | 1200 | 3520 |
| CF69 | Uridine Phosphorylase 1/UPP1 | Human | E.coli | 840 | 2520 |
| C273 | UROD | Human | E.coli | 1200 | 3520 |
| CA11 | Uroplakin-2/UPK2 | Human | Human cells | 1200 | 3520 |
| C268 | Uroporphyrinogen-III synthase/UROS | Human | E.coli | 1200 | 3520 |
| CF48 | Valosin-containing protein/VCP | Human | E.coli | 1200 | 3520 |
| C547 | Vanin-1/Pantetheinase/VNN1 | Human | Human cells | 840 | 2520 |
| C651 | Vanin-2/VNN2 | Human | Human cells | 840 | 2520 |
| C394 | VASN/Vasorin | Human | Human cells | 840 | 2520 |
| C699 | VEGF121/Vascular Endothelial Growth Factor Isoform 121 | Human | Human cells | 1200 | 3520 |
| C083 | VEGF165/VEGFA | Human | Human cells | 1200 | 3520 |
| C744 | VEGFA/Vascular endothelial growth factor A | Human | E.coli | 1200 | 3520 |
| CJ96 | VEGFA/VEGF164 | Rat | P. pastoris | 936 | 2800 |
| CD73 | VEGF-A164/Vascular endothelial growth factor A | Mouse | P. pastoris | 1200 | 3520 |
| C546 | VEGFC | Human | Human cells | 936 | 2800 |
| C498 | VEGFD | Human | Human cells | 840 | 2520 |
| CD18 | VEGFD/FIGF/Vascular endothelial growth factor D | Mouse | Human cells | 840 | 2520 |
| CJ93 | VEGFR1/FLT1 | Human | Human cells | 720 | 2000 |
| CJ92 | VEGFR2/Flk-1/CD309/KDR | Human | Human cells | 720 | 2000 |
| C778 | Vesicle-associated membrane protein-associated protein B/C/VAPB | Human | E.coli | 760 | 2000 |
| C264 | Vinculin | Human | E.coli | 1200 | 3520 |
| CC78 | VIP/VIP peptides | Human | Human cells | 840 | 2520 |
| C265 | Visinin-like protein 1/HLP3/VSNL1 | Human | E.coli | 1200 | 3520 |
| CA78 | Vitamin K-dependent protein C/PROC | Human | Human cells | 1200 | 3520 |
| C395 | Vitronectin/VTN | Human | Human cells | 240 | 640 |
| C650 | VMO1/Vitelline membrane outer layer 1 homolog | Human | Human cells | 840 | 2520 |
| CI42 | VRK3/Vaccinia-related kinase 3 | Human | Human cells | 1200 | 3520 |
| CJ71 | V-set and transmembrane domain-containing protein 1/VSTM1 | Human | Human cells | 840 | 2520 |
| C548 | VSIG2 | Human | Human cells | 640 | 1760 |
| C549 | VSIG4 | Human | Human cells | 560 | 1680 |
| CD69 | VSIG4(Fc fusion) | Human | Human cells | 560 | 1680 |
| CI23 | VSTM2A/V-set and transmembrane domain-containing protein 2A | Human | Human cells | 1200 | 3520 |
| C300 | WARS/TrpRS | Human | E.coli | 760 | 2000 |
| CK09 | WDYHV1/Protein N-terminal glutamine amidohydrolase | Human | E.coli | 840 | 2520 |
| C396 | WIF-1/Wnt inhibitory factor 1 | Human | Human cells | 640 | 1760 |
| CE39 | WW domain-binding protein 1/WBP1 | Human | E.coli | 1200 | 3520 |
| CE22 | WW domain-binding protein 2/WBP2 | Human | E.coli | 1200 | 3520 |
| CC33 | XCL1/Lymphotactin/LTN | Human | Human cells | 840 | 2520 |
| CE92 | XPNPEP3/Probable Xaa-Pro aminopeptidase 3 | Human | E.coli | 1200 | 3520 |
| CH59 | YY1/Transcriptional repressor protein YY1 | Human | E.coli | 1200 | 3520 |
| C282 | Z-DNA-binding protein 1/ZBP1 | Human | E.coli | 1200 | 3520 |
| CH34 | Zinc finger and BTB domain-containing protein 9/ZBTB9 | Human | E.coli | 1200 | 3520 |
| CE55 | Zinc finger BED domain-containing protein 1/ZBED1/ALTE | Human | E.coli | 1200 | 3520 |
| CG05 | Zinc Finger C4H2 Domain-Containing Protein/Zc4H2 | Human | E.coli | 1200 | 3520 |
| CG69 | Zinc finger HIT domain-containing protein 1/ZNHIT1/ZNFN4A1 | Human | E.coli | 1200 | 3520 |
| CE77 | Zinc finger MYND domain-containing protein 10/ZMYND10 | Human | E.coli | 840 | 2520 |
| C280 | Zinc finger MYND domain-containing protein 19/ZMYND19 | Human | E.coli | 1200 | 3520 |
| CE28 | Zinc finger protein 100/ZNF100 | Human | E.coli | 1200 | 3520 |
| CE83 | Zinc finger protein 22/ZNF22 | Human | E.coli | 1200 | 3520 |
| CG55 | Zinc finger protein 225/EGR1/ZNF225 | Human | E.coli | 1200 | 3520 |
| CE70 | Zinc finger protein 70/ZNF70 | Human | E.coli | 1200 | 3520 |
| CE51 | Zinc finger protein 75A/ZNF75A | Human | E.coli | 1200 | 3520 |
| CF74 | Zinc finger protein 762/ZNF762/ZIK1 | Human | E.coli | 1200 | 3520 |
| C429 | Zinc-alpha-2-glycoprotein/ZAG/AZGP1 | Human | Human cells | 840 | 2520 |
| CG60 | ZNRF1/E3 ubiquitin-protein ligase ZNRF1 | Human | E.coli | 1200 | 3520 |
| C267 | ZW10 interactor/ZWINT | Human | E.coli | 1200 | 3520 |
| CP25 | α-2-HS-Glycoprotein//AHSG/Fetuin A (C-10His) | Mouse | Human Cells | 480 | 1440 |
| CP26 | α-2-HS-Glycoprotein//AHSG/Fetuin A (C-10His) | Macaca mulatta | Human Cells | 480 | 1440 |
| CM23 | α-Synuclein/SNCA | Mouse | E.coli | 400 | 840 |












